Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Chloro-7-(trifluoromethyl)quinoline
BUTTPARK 15\09-27 · 4-Chloro-7-(trifluoroMethyl)quin · 4-CHLORO-7-(TRIFLUOROMETHYL)QUINOLINE · Quinoline, 4-chloro-7-(trifluoromethyl)- · 4-Chloro-7-(trifluoromethyl)quinoline 98% · 4-CHLORO-7-(TRIFLUOROMETHYL)QUINOLINE, 9 8% · 4-Chloro-7-(trifluoromethyl)quinoline ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 346-55-4 |
|---|---|
| 분자식 | C10H5ClF3N |
| 평균 분자량 | 231.6 g/mol |
| 단동위원소 질량 | 231.0062615 g/mol |
| SMILES | FC(F)(F)c1ccc2c(Cl)ccnc2c1 |
| InChIKey | LLRQVSZVVAKRJA-UHFFFAOYSA-N |
| PubChem CID | 67668 |
| ChEMBL | CHEMBL567057 |
| EC No. | 206-471-0 |
| DTXSID | DTXSID00188170 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 12.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 231 |
| 녹는점 | 69-71 °C(lit.) |
| 끓는 점 | 265.5±35.0 °C(Predicted) |
| 밀도 | 1.4120 (estimate) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 클로로포름: 용해성25mg/mL, 투명, 무색 |
| pKa(산도 계수) | 1.18±0.27(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 라이트 베이지부터 베이지까지 |
| InChI | 1S/C10H5ClF3N/c11-8-3-4-15-9-5-6(10(12,13)14)1-2-7(8)9/h1-5H |
| InChIKey | LLRQVSZVVAKRJA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(Cl)ccnc2c1 |
| NIST | 4-Chloro-7-(trifluoromethyl)quinoline(346-55-4) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2933499090 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-37/39-24/25 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Chloro-7-(trifluoromethyl)quinoline is a reagent in the preparation of piperazinylquinolines as breast cancer inhibitors.