트리플루오로메탄술폰산무수물
트리플루오로메탄술폰산무수물 · Tf2O · TRIFLIC ANHYDRIDE · Trifluoromethylsulfonic anhydride · TFO2 · trifluoromethylsulfonyl trifluoromethanesulfonate · TRIFLUOROMETHANESULFONIC ACID ANHYDRIDE · TRIFLUOROMETHANESULPHONIC ANHYDRIDE
식별자 및 물리적 특성
| CAS No. | 358-23-6 |
|---|---|
| 분자식 | C2F6O5S2 |
| 평균 분자량 | 282.14 g/mol |
| 단동위원소 질량 | 281.90913442 g/mol |
| SMILES | O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChIKey | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| PubChem CID | 67749 |
| ChEBI | CHEBI:48509 |
| EC No. | 206-616-8 |
| DTXSID | DTXSID501014629 |
| 현지명 | 트리플루오로메탄술폰산무수물 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 94.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 11 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 370 |
| 물질 분류 | Other Classes -> Acid Anhydrides, Other |
| PFAS | PFAS -> Suspected persistent, mobile, toxic (PMT) PFAS or PFAS-like compoundsPFAS -> PFAS identified in REACH Regulation EC No. 1272/2008 |
| SpringerMaterials Properties | Schoenflies notation |
| 밀도 | 1.677 @25 °C1.677 g/mL at 25 °C (lit.) |
| 증기압 | 8.0 [mmHg]8 [mm Hg] @20 °C8 mm Hg ( 20 °C) |
| Physical Description | Colorless hygroscopic liquid[Merck Index] Clear colorless liquid[Sigma-Aldrich MSDS] |
| 녹는점 | -80°C |
| 끓는 점 | 81-83 °C (lit.) |
| 증기 밀도 | 5.2 (vs air) |
| 굴절률 | n20/D 1.321(lit.) |
| 인화점 | 81-83°C |
| 저장 조건 | Store below +30°C. |
| 용해도 | 디클로로메탄과 혼합 가능. 탄화수소와 섞이지 않습니다. |
| 물리적 상태 | 액체 |
| 비중 | 1.677 |
| 색상 | 투명한 무색~연한 갈색 |
| 용해도 | 물과 격렬하게 반응함 |
| BRN | 1813600 |
| 안정성 | 흡습성, 수분 민감성 |
| InChI | 1S/C2F6O5S2/c3-1(4,5)14(9,10)13-15(11,12)2(6,7)8 |
| InChIKey | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| LogP(분배 계수) | 0.3 at 25℃ |
| NIST | Trifluoromethanesulfonic anhydride(358-23-6) |
| EPA | Methanesulfonic acid, trifluoro-, anhydride (358-23-6) |
화학적 성질
clear colorless to light brown liquid
안전 및 규제
| GHS 분류 | DangerH272 (51.1%): May intensify fireoxidizer [Danger Oxidizing liquidsOxidizing solids]P210, P220, P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P319, P321, P330, P363, P370+P378, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 227 reports by companies from 22 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Methanesulfonic acid, trifluoro-, anhydrideStatus: Active Update: 03-04-2020 https://echa.europa.eu/registration-dossier/-/registered-dossier/22478Trifluoromethanesulphonic anhydride: HSNO Approval: HSR004747 Approved with controls |
| 유해성 요약 | Reacts violently with waterCorrosive[Merck Index] Reacts violently with waterCauses burnsInhalation may cause corrosive injuries to upper respiratory tract and lungsHarmful by ingestion[Sigma-Aldrich MSDS] See Trifluoromethanesulfonic acid. |
| Hazard Classes and Categories | Ox. Liq. 2 (51.1%) |
| CSL Reaction Information | CSL00005TETRAHYDROFURAN + Triflic anhydrideCan polymerize, large exotherm. Avoid combination on larger scale.User-Reported6/29/1810/2/17 |
| Protective Action Criteria (PAC) | 3.0 [mg/m3]33 [mg/m3]200 [mg/m3] |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 독성 | LD50 orally in Rabbit: 1012 mg/kg |
| 관세 코드 | 29049020 |
| 위험 문구(R) | 14-21/22-34-35-22-40 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-43-45-8 |
| 포장분류 | I |
| 위험 등급 | 8Acute Tox. 4 OralEye Dam. 1Ox. Liq. 2Skin Corr. 1BSTOT SE 3 |
| F 고인화성물질 | 10-21 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 5.1B - Oxidizing hazardous materials |
| 함량 및 규제정보 | 물질구분: 유독물질혼합물(제품)함량정보: 무수 트리플루오로메탄술폰산[Trifluoromethanesulfonic anhydride358-23-6] 및 이를 5% 이상 함유한 혼합물 |
| 유해화학물질 필터링 | 2020-1-958(신규화학물질) |
용도
개요
Trifluoromethanesulfonic anhydride, also known as triflic anhydride, has proven to be an extraordinary reagent for a broad range of transformations. As a commercially and readily available reagent, It has been widely used in synthetic chemistry due to its high electrophilicity. Given its high affinity towards O-nucleophiles, reaction with alcohols, carbonyls, sulfur phosphorus- and iodine oxides towards the formation of the corresponding triflates is strongly favored. As one of the premier leaving groups in organic chemistry, the generated triflates then open the door to various downstream transformations, including (but not limited to) substitution reactions, cross-coupling processes, redox reactions, and rearrangements[1-2].
용도
Trifluoromethanesulfonic Anhydride is a strong electrophile used in chemical synthesis for introducing the triflyl group.