Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Silane, dimethoxymethyl(3,3,3-trifluoropropyl)-
DIMETHOXYMETHYL(3,3,3-TRIFLUOROPROPYL)SILANE · TRIFLUOROPROPYLMETHYLDIMETHOXYSILANE · 3,3,3-Trifluorpropylmethyldimethoxysilan · 3,3,3-Trifluorpropyl Methyl Dimethoxysilane · (3,3,3-TRIFLUOROPROPYL)METHYLDIMETHOXYSILANE · METHYL(3,3,3-TRIFLUOROPROPYL)DIMETHOXYSILANE · Methyldimethoxy(3,3,3-trifluoropropyl)silane · 3,3,3-Trifluoropropyldimethoxy(methyl)silane
식별자 및 물리적 특성
| CAS No. | 358-67-8 |
|---|---|
| 분자식 | C6H13F3O2Si |
| 평균 분자량 | 202.25 g/mol |
| 단동위원소 질량 | 202.06369067 g/mol |
| SMILES | CO[Si](C)(CCC(F)(F)F)OC |
| InChIKey | DIJRHOZMLZRNLM-UHFFFAOYSA-N |
| PubChem CID | 67751 |
| EC No. | 206-619-4 |
| DTXSID | DTXSID30957179 |
화학 및 물리적 성질
| 극성 표면적 | 18.5 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 133 |
| 녹는점 | 27 °C |
| 끓는 점 | 85 °C |
| 밀도 | 1.089 g/mL at 20 °C(lit.) |
| 굴절률 | n20/D 1.358 |
| 인화점 | 58°C |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| 비중 | 1.095 |
| BRN | 1753237 |
| InChI | InChI=1S/C6H13F3O2Si/c1-10-5(11-2)12-4-3-6(7,8)9/h5H,3-4,12H2,1-2H3 |
| InChIKey | YEROEIVBCZSQJY-UHFFFAOYSA-N |
| SMILES | [SiH2](C(OC)OC)CCC(F)(F)F |
| EPA | Silane, dimethoxymethyl(3,3,3-trifluoropropyl)- (358-67-8) |
화학적 성질
Colorless clear liquid
안전 및 규제
| GHS 분류 | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 1993 3/PG 3 |
| 관세 코드 | 2931900090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 포장분류 | III |
| 위험 등급 | 3Flam. Liq. 3 |
| F 고인화성물질 | 10-21 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
3,3,3-Trifluoropropylmethyldimethoxysilane is mainly used in superhydrophobic coatings and surface treatment of inorganic fillers. It can be used in cosmetics and display or semiconductor devices production.