Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
안트라플라빈
안트라플라빈 · 2,6-dihydroxy-anthraquinon · 2,6-Dihydroxy-9,10-anthracenedione · 2,6-DHAQ · NSC-33531 · Anthraflavin · anthraflavicaci · Anthrafravic acid
식별자 및 물리적 특성
| CAS No. | 84-60-6 |
|---|---|
| 분자식 | C14H8O4 |
| 평균 분자량 | 240.21 g/mol |
| 단동위원소 질량 | 240.04225874 g/mol |
| SMILES | O=C1c2ccc(O)cc2C(=O)c2ccc(O)cc21 |
| InChIKey | APAJFZPFBHMFQR-UHFFFAOYSA-N |
| PubChem CID | 6776 |
| ChEMBL | CHEMBL298398 |
| ChEBI | CHEBI:34250 |
| EC No. | 201-544-3 |
| DTXSID | DTXSID6036546 |
| 현지명 | 안트라플라빈 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 74.6 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 342 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | >320 °C(lit.) |
| 끓는 점 | 342.92°C (rough estimate) |
| 밀도 | 1.3032 (rough estimate) |
| 굴절률 | 1.5430 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO에 용해됨 |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 6.72±0.20(Predicted) |
| 색상 | Light yellow to Brown to Dark green |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
| InChIKey | APAJFZPFBHMFQR-UHFFFAOYSA-N |
| SMILES | Oc1ccc2C(=O)c3cc(O)ccc3C(=O)c2c1 |
| LogP(분배 계수) | 3.360 (est) |
| EPA | 9,10-Anthracenedione, 2,6-dihydroxy- (84-60-6) |
화학적 성질
solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 9,10-Anthracenedione, 2,6-dihydroxy- |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | CB6675000 |
| 관세 코드 | 29146990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-36/37 |
| 기존화학 물질 | KE-10778 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Anthraflavic acid can be used as a starting material to synthesize tetrahydroxy tetrathiafulvalene (TTF) derivatives, which are used as redox-active building blocks in supramolecular and materials science. It is also utilized to prepare phosphanylidene anthra[2,1-b]furans by reacting with dialkyl acetylenedicarboxylates and triphenylphosphine.