Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4,6-Trifluoroaniline
2,4,6-TRIFLUOROBENZENAMINE · 2,4,6-Trifluoroanili · 2,4,6-Trifluoroanilin · 2,4,6-trifluoroaniune · 2,4,6-TRIFLUOROANILINE · 2,4,6-Trifluoroaniline,98% · 2,4,6-TRIFLUOROANILINE, 97+% · Benzenamine, 2,4,6-trifluoro-
식별자 및 물리적 특성
| CAS No. | 363-81-5 |
|---|---|
| 분자식 | C6H4F3N |
| 평균 분자량 | 147.1 g/mol |
| 단동위원소 질량 | 147.02958379 g/mol |
| SMILES | Nc1c(F)cc(F)cc1F |
| InChIKey | BJSVKBGQDHUBHZ-UHFFFAOYSA-N |
| PubChem CID | 67765 |
| EC No. | 206-660-8 |
| DTXSID | DTXSID80189842 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 108 |
| LogP(분배 계수) | 1.81 |
| 녹는점 | 33-37 °C (lit.) |
| 끓는 점 | 57 °C/22 mmHg (lit.) |
| 밀도 | 1.3510 (estimate) |
| 인화점 | 136 °F |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| pKa(산도 계수) | 1.87±0.10(Predicted) |
| 물리적 상태 | powder to lump to clear liquid |
| 색상 | White or Colorless to Light yellow |
| 용해도 | 물에 불용성. |
| BRN | 2831022 |
| InChI | InChI=1S/C6H4F3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| InChIKey | BJSVKBGQDHUBHZ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=C(F)C=C1F |
| NIST | 2,4,6-Trifluoroaniline(363-81-5) |
화학적 성질
COLORLESS TO LIGHT GREY CRYSTALS
안전 및 규제
| GHS 분류 | DangerH228 (98%): Flammable solid [Danger Flammable solids]P210, P240, P241, P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Sol. 2 (98%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1325 4.1/PG 3 |
| 관세 코드 | 29214200 |
| 위험 문구(R) | 36/37-41-38-21/22-11-37/38 |
| 위험 표시 | Xi,Xn,F |
| 안전 문구(S) | 26-39-36/37/39-16 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Dam. 1Flam. Sol. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 4.1B - Flammable solid hazardous materials |
용도
용도
2,4,6-Trifluoroaniline was used in the synthesis of 3-nitro-2,4,6 -trifluoroacetanilide; eries of N-phenyl-N-(1- phenyl cyclopentyl)-methyl ureas and 4-substituted 2,6-difluoro N-aryl pyridinones.