Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디플로로니트로벤젠(2,5-)
디플로로니트로벤젠(2,5-) · 2,5-다이플루오로나이트로벤젠 · 1,4-DIFLUORO-2-NITROBENZENE · AKOS BBS-00006468 · 2,5-Difluoronitroben · 3,5-diflurobenzalcohol · 2,5-Difluotonitrobenzene · 2,5-DIFLUORONITROBENZENE
식별자 및 물리적 특성
| CAS No. | 364-74-9 |
|---|---|
| 분자식 | C6H3F2NO2 |
| 평균 분자량 | 159.09 g/mol |
| 단동위원소 질량 | 159.01318478 g/mol |
| SMILES | O=[N+]([O-])c1cc(F)ccc1F |
| InChIKey | XNJAYQHWXYJBBD-UHFFFAOYSA-N |
| PubChem CID | 67767 |
| ChEMBL | CHEMBL164704 |
| EC No. | 206-663-4 |
| DTXSID | DTXSID60189921 |
| 현지명 | 디플로로니트로벤젠(2,5-) |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 159 |
| 물질 분류 | Nitrogen Compounds -> Nitros, Aromatic |
| SpringerMaterials Properties | Optical coefficient |
| LogP(분배 계수) | 1.86 |
| 증기압 | 0.35 [mmHg] |
| Physical Description | Light yellow liquid[Alfa Aesar MSDS] |
| 녹는점 | -11.7 °C (lit.) |
| 끓는 점 | 206.5 °C (lit.) |
| 밀도 | 1.467 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.509(lit.) |
| 인화점 | 194 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 액체 |
| 색상 | 맑은 노란색 |
| 비중 | 1.467 |
| 용해도 | 불용성 |
| BRN | 2210200 |
| InChI | InChI=1S/C6H3F2NO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| InChIKey | XNJAYQHWXYJBBD-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1[N+]([O-])=O |
| NIST | 2,5-Difluoronitrobenzene(364-74-9) |
화학적 성질
CLEAR YELLOW LIQUID
안전 및 규제
| GHS 분류 | WarningH302 (16.3%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Causes methemoglobinemia in acute oral studies of rats[RTECS] A skin and strong eye irritantToxic by inhalationHarmful by ingestion and skin absorptionMay have cumulative effects[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Acute Tox. 4 (16.3%) |
| 유해 작용 | Methemoglobinemia - The presence of increased methemoglobin in the bloodthe compound is classified as secondary toxic effect |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | CZ5715000 |
| 운송 번호(UN) | 2810 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 포장분류 | III |
| 위험 등급 | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2,5-Difluoronitrobenzene was used in the synthesis of :N-alkylated 2-arylaminobenzimidazolesquinoxalinonesN-(2-nitro-4-fluorophenyl)-l,2,3,4-tetrahydroisoquinoline