Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-브로모-2,5-디플로로벤젠
1-브로모-2,5-디플로로벤젠 · 1-브로모-2,5-다이플루오로벤젠 · 2-BROMO-1,4-DIFLUOROBENZENE · NSC 10250 · 2-Bromo-1,4-difL · 1-Bromo-2,5-difluoro · 2,5-DIFLUOROBROMOBENZENE · 2-Brom-1,4-difluorbenzol
식별자 및 물리적 특성
| CAS No. | 399-94-0 |
|---|---|
| 분자식 | C6H3BrF2 |
| 평균 분자량 | 192.99 g/mol |
| 단동위원소 질량 | 191.93861864 g/mol |
| SMILES | Fc1ccc(F)c(Br)c1 |
| InChIKey | XCRCSPKQEDMVBO-UHFFFAOYSA-N |
| PubChem CID | 67862 |
| EC No. | 206-920-0 |
| DTXSID | DTXSID50192949 |
| 현지명 | 1-브로모-2,5-디플로로벤젠 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 97.1 |
| 녹는점 | −31 °C(lit.) |
| 끓는 점 | 58-59 °C20 mm Hg(lit.) |
| 밀도 | 1.708 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.508(lit.) |
| 인화점 | 149 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 비중 | 1.708 |
| 색상 | Colorless to Light yellow to Light orange |
| 용해도 | 불용성 |
| BRN | 1680893 |
| InChI | InChI=1S/C6H3BrF2/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| InChIKey | XCRCSPKQEDMVBO-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1Br |
| NIST | Benzene, 2-bromo-1,4-difluoro-(399-94-0) |
화학적 성질
CLEAR COLOURLESS LIQUID
안전 및 규제
| GHS 분류 | WarningH315 (98%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (98%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2922 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi,F,Xn |
| 안전 문구(S) | 26-36/37/39-2637/39-37/39 |
| 위험 등급 | IRRITANT, FLAMMABLEEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Flammable |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2-Bromo-1,4-difluorobenzene has been used in the preparation of 1,4-difluoroanthraquinone, a precursor to ametantrone.
일반 설명
Lithiation of 2-bromo-1,4-difluorobenzene in the presence of lithium diisopropylamide (LDA) in THF-hexane, butyllithium in diethyl ether-hexane and butyllithium in THF-hexane has been reported.