Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에틸 펜타플루오로프로니온에이트
에틸펜타플루오로프로니온에이트 · 에틸 펜타플루오로프로피온에이트 · Ethyl 2,2,3,3,3-pentafluoropropanoate · TIMTEC-BB SBB008810 · RARECHEM AL BI 0480 · ETHYL PENTAFLUOROPROPIOTE · ETHYL PERFLUOROPROPIONATE · Ethyl pentafluoropentanoate
식별자 및 물리적 특성
| CAS No. | 426-65-3 |
|---|---|
| 분자식 | C5H5F5O2 |
| 평균 분자량 | 192.08 g/mol |
| 단동위원소 질량 | 192.0209705 g/mol |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)F |
| InChIKey | DBOFMRQAMAZKQY-UHFFFAOYSA-N |
| PubChem CID | 67928 |
| EC No. | 207-043-6 |
| DTXSID | DTXSID2059980 |
| 현지명 | 에틸 펜타플루오로프로니온에이트 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 173 |
| PFAS | PFAS -> Other/unspecified |
| 녹는점 | 75.5°C |
| 끓는 점 | 75-76 °C (lit.) |
| 밀도 | 1.299 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.301(lit.) |
| 인화점 | 35 °F |
| 저장 조건 | Inert atmosphere,2-8°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| 비중 | 1.299 |
| BRN | 1779789 |
| InChI | InChI=1S/C5H5F5O2/c1-2-12-3(11)4(6,7)5(8,9)10/h2H2,1H3 |
| InChIKey | DBOFMRQAMAZKQY-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(F)(F)C(F)(F)F |
| EPA | Ethyl perfluoropropionate (426-65-3) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | S - indicates a substance that is identified in a final Significant New Use Rule. |
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3272 3/PG 2 |
| 관세 코드 | 29159000 |
| 위험 문구(R) | 11-36/37/38 |
| 위험 표시 | F,Xi |
| 안전 문구(S) | 16-26-33-36 |
| 포장분류 | II |
| 위험 등급 | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Flammable |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Ethyl pentafluoropropionate has been used:as pentafluoroethyl source in the direct synthesis of pentafluoroethyl copper (CuC2F5)in the synthesis of C-6 substituted fluoroalkenyl 2,4-dimethoxypyrimidine derivative