Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Decafluorobiphenyl
perfluoro-1,1'-biphenyl · Decafluorobiph · Perfluorodiphenyl · PERFLUOROBIPHENYL · Decaflourobipheny · Decafluorbiphenyl · DECAFLUOROBIPHENYL · Biphenyl, decafluoro-
식별자 및 물리적 특성
| CAS No. | 434-90-2 |
|---|---|
| 분자식 | C12F10 |
| 평균 분자량 | 334.11 g/mol |
| 단동위원소 질량 | 333.9840322 g/mol |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChIKey | ONUFSRWQCKNVSL-UHFFFAOYSA-N |
| PubChem CID | 67949 |
| EC No. | 207-107-3 |
| DTXSID | DTXSID7075341 |
화학 및 물리적 성질
| XLogP | 4.6 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 10 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 326 |
| PFAS | PFAS -> Other/unspecified |
| Polymers | Other Classes -> Halogenated Polyaromatics |
| SpringerMaterials Properties | Schoenflies notation |
| Physical Description | White crystalline powder[Alfa Aesar MSDS] |
| 녹는점 | 68-70 °C(lit.) |
| 끓는 점 | 206 °C(lit.) |
| 밀도 | 1,785 g/cm3 |
| 굴절률 | 1.3170 (estimate) |
| 인화점 | 206°C |
| 저장 조건 | room temp |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 결정질 고체 |
| 색상 | 하얀색 |
| 용해도 | 물에 불용성. |
| BRN | 1916978 |
| 헨리 상수 | 6.7×10-3 mol/(m3Pa) at 25℃, Hiatt (2013) |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C12F10/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16 |
| InChIKey | ONUFSRWQCKNVSL-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(c(F)c1F)-c2c(F)c(F)c(F)c(F)c2F |
| NIST | 1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6,6'-decafluoro-(434-90-2) |
| EPA | Decafluorobiphenyl (434-90-2) |
화학적 성질
white crystals or powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 60% (3 of 5) of all reports.WarningH302 (20%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | May cause irritation[Alfa Aesar MSDS] See Polychlorinated biphenyls. See Polybrominated biphenyls. |
| Hazard Classes and Categories | Acute Tox. 4 (20%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3152 9/PG 2 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 36/37/38-63-43-23/24/25-45-67-40 |
| 위험 표시 | Xi,T,Xn |
| 안전 문구(S) | 22-24/25-36/37-23-53-37/39-26 |
| 포장분류 | II |
| 위험 등급 | 9 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Decafluorobiphenyl is used as an intermediate in organic synthesis and in pharmaceuticals.