Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Chloro-4-(trifluoromethyl)aniline
3-CHLORO-4-(TRIFLUOROMETHYL)ANILINE · Sorafenib Impurity 138 · 4-Amino-2-chlorobenzotrifluoride · 4-Amino-2-chlorobenzotrifluoride 98+% · 3-Chloro-4-(trifluoromethyl)benzenamine · 3-Chloro-4-(trifluoromethyl)aniline,97% · [3-chloro-4-(trifluoromethyl)phenyl]amine · Benzenamine, 3-chloro-4-(trifluoromethyl)-
식별자 및 물리적 특성
| CAS No. | 445-13-6 |
|---|---|
| 분자식 | C7H5ClF3N |
| 평균 분자량 | 195.57 g/mol |
| 단동위원소 질량 | 195.0062615 g/mol |
| SMILES | Nc1ccc(C(F)(F)F)c(Cl)c1 |
| InChIKey | KZAMRRANXJVDCD-UHFFFAOYSA-N |
| PubChem CID | 67962 |
| EC No. | 207-152-9 |
| DTXSID | DTXSID40196198 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 159 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 끓는 점 | 112-115 °C |
| 밀도 | 1.425±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,2-8°C |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 1.71±0.10(Predicted) |
| 색상 | Faintly hazy khaki |
| InChI | InChI=1S/C7H5ClF3N/c8-6-3-4(12)1-2-5(6)7(9,10)11/h1-3H,12H2 |
| InChIKey | KZAMRRANXJVDCD-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C(F)(F)F)C(Cl)=C1 |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 운송 번호(UN) | 2810 |
| 관세 코드 | 2921420090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39 |
| 포장분류 | Ⅲ |
| 위험 등급 | 6.1 |
| 위험 참고 사항 | Irritant |
용도
용도
3-Chloro-4-trifluoromethylaniline