Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
플로로벤질브로마이드
플로로벤질브로마이드 · 2-플루오로벤질 브로마이드 · 1-(BROMOMETHYL)-2-FLUORO-BENZENE · 2-Fluorobenzyl bromi · O-FLUOROBENZYL BROMIDE · 2-FLUOROBENZYL BROMIDE · 2-Fluarobenzyl bromide · à-bromo-2-fluorotoluene
식별자 및 물리적 특성
| CAS No. | 446-48-0 |
|---|---|
| 분자식 | C7H6BrF |
| 평균 분자량 | 189.02 g/mol |
| 단동위원소 질량 | 187.96369051 g/mol |
| SMILES | Fc1ccccc1CBr |
| InChIKey | FFWQLZFIMNTUCZ-UHFFFAOYSA-N |
| PubChem CID | 67968 |
| EC No. | 207-169-1 |
| DTXSID | DTXSID50196240 |
| 현지명 | 플로로벤질브로마이드 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 85 |
| 끓는 점 | 84-85 °C15 mm Hg(lit.) |
| 밀도 | 1.567 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.552(lit.) |
| 인화점 | 181 °F |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 액체 |
| 비중 | 1.567 |
| 색상 | 무색투명~미황색 |
| BRN | 1099894 |
| InChI | InChI=1S/C7H6BrF/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | FFWQLZFIMNTUCZ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1F |
| NIST | 2-Fluorobenzyl bromide(446-48-0) |
화학적 성질
clear colorless to slightly yellow liquid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 52 reports by companies from 11 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzene, 1-(bromomethyl)-2-fluoro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 34-36/37 |
| 위험 표시 | C |
| 안전 문구(S) | 23-26-27-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 8Skin Corr. 1BSTOT SE 3 |
| 위험 참고 사항 | Corrosive/Lachrymatory |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
2-Fluorobenzyl bromide was used:in the synthesis of 2-pyrrolo[2,3-d]pyrimidinesas alkylating agent during the synthesis of 8-alkylated imidazolo[1,2-a]pyrimid-5-onesin the synthesis of prasugrel