Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디플로로툴루엔(2,4-)
2,4-다이플루오로톨루엔 · 디플로로툴루엔(2,4-) · 2,4-Difluorobenzyl · difluorotoluene · 2,4-DIFLUOROTOLUNE · 2,4-DIFLUOROTOLUINE · 2,4-DIFLUOROTOLUENE · 2,4-Difluorotoluene99%
식별자 및 물리적 특성
| CAS No. | 452-76-6 |
|---|---|
| 분자식 | C7H6F2 |
| 평균 분자량 | 128.12 g/mol |
| 단동위원소 질량 | 128.04375663 g/mol |
| SMILES | Cc1ccc(F)cc1F |
| InChIKey | MPXDAIBTYWGBSL-UHFFFAOYSA-N |
| PubChem CID | 67983 |
| EC No. | 207-211-9 |
| DTXSID | DTXSID70196429 |
| 현지명 | 디플로로툴루엔(2,4-) |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 92.9 |
| 물질 분류 | Other Classes -> Halogenated Monoaromatics |
| SpringerMaterials Properties | Hindering potential |
| Physical Description | Colorless liquid with an aromatic odor[Alfa Aesar MSDS] |
| 녹는점 | -35 °C |
| 끓는 점 | 113-117 °C (lit.) |
| 밀도 | 1.12 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.449(lit.) |
| 인화점 | 59 °F |
| 저장 조건 | Sealed in dry,2-8°C |
| 물리적 상태 | 액체 |
| 비중 | 1.120 |
| 색상 | 무색의 |
| BRN | 1931681 |
| InChI | InChI=1S/C7H6F2/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | MPXDAIBTYWGBSL-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1F |
| NIST | 2,4-Difluorotoluene(452-76-6) |
화학적 성질
colorless to light yellow liqui
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Benzene, 2,4-difluoro-1-methyl-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Highly flammableA skin and strong eye irritant[Alfa Aesar MSDS] See Toluene. |
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1993 3/PG 2 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 11 |
| 위험 표시 | F,F+ |
| 안전 문구(S) | 16-29-33 |
| 포장분류 | II |
| 위험 등급 | 3Flam. Liq. 2 |
| 위험 참고 사항 | Flammable |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
2,4-Difluorotoluene was used in the synthesis of new hydrophobic isosteres of pyrimidines and purine nucleosides.
일반 설명
2,4-Difluorotoluene was synthesized as a nucleotide analog and was incorporated into DNA and undergoes replication by DNA polymerase enzymes.