Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-플루오로-4-메틸아닐린
2-플루오로-4-메틸아닐린 · 2-FLUORO-P-TOLUIDINE · 2-flu · NH2=1 · 2-fluoro-4-met · 2-fluoro-p-toluidin · TIMTEC-BB SBB006650 · 2-Fluoro-4-methylani
식별자 및 물리적 특성
| CAS No. | 452-80-2 |
|---|---|
| 분자식 | C7H8FN |
| 평균 분자량 | 125.14 g/mol |
| 단동위원소 질량 | 125.06407748 g/mol |
| SMILES | Cc1ccc(N)c(F)c1 |
| InChIKey | ZQEXBVHABAJPHJ-UHFFFAOYSA-N |
| PubChem CID | 67984 |
| EC No. | 610-237-7 |
| DTXSID | DTXSID40196431 |
| 현지명 | 2-플루오로-4-메틸아닐린 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 94.9 |
| 녹는점 | 3 °C |
| 끓는 점 | 70-71 °C/7 mmHg (lit.) |
| 밀도 | 1.108 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.533(lit.) |
| 인화점 | 175 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 3+-.0.10(Predicted) |
| 색상 | 투명한 주황색에서 주황색 갈색까지 |
| 용해도 | 물과 섞이지 않습니다. |
| BRN | 2637578 |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
| InChIKey | ZQEXBVHABAJPHJ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C)C=C1F |
화학적 성질
clear orange to orange-brown liquid
안전 및 규제
| GHS 분류 | DangerH301 (89.6%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P261, P262, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (89.6%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | XU6650000 |
| 운송 번호(UN) | UN 2810 6.1/PG 3 |
| 관세 코드 | 29214300 |
| 위험 문구(R) | 23/24/25-36/37/38 |
| 위험 표시 | T,Xi |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Toxic/Irritant |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
2-Fluoro-4-methylaniline is used in the preparation of 6-chloro-5-fluoroindole via Leimgruber-Batcho reaction. It is also used in the preparation of an (S)-amino alcohol, 2-amino-3-(2-fluoro-4-methylphenyl)-propan-1-ol.
일반 설명
Rat liver microsomal metabolism of 2-fluoro-4-methylaniline was studied by HPLC.