Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-플루오로-3-니트로벤조산
4-플루오로-3-나이트로벤조산 · 4-플루오로-3-니트로벤조산 · 3-NITRO-4-FLUOROBENZOIC ACID · NSC 10311 · BUTTPARK 32\01-78 · RARECHEM AL BO 0969 · TIMTEC-BB SBB008336 · Afatinib Impurity 100
식별자 및 물리적 특성
| CAS No. | 453-71-4 |
|---|---|
| 분자식 | C7H4FNO4 |
| 평균 분자량 | 185.11 g/mol |
| 단동위원소 질량 | 185.01243583 g/mol |
| SMILES | O=C(O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChIKey | BOJWTAQWPVBIPG-UHFFFAOYSA-N |
| PubChem CID | 67987 |
| EC No. | 207-221-3 |
| DTXSID | DTXSID30196465 |
| 현지명 | 4-플루오로-3-니트로벤조산 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| 녹는점 | 123-126 °C (lit.) |
| 끓는 점 | 92°C 15mm |
| 밀도 | 1.5071 (estimate) |
| 인화점 | 92°C/15mm |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 95% 에탄올: 용해성50mg/mL, 투명, 연황색 |
| pKa(산도 계수) | 3.54±0.10(Predicted) |
| 물리적 상태 | 분말 또는 결정 |
| 색상 | 밝은 노란색에서 황갈색까지 |
| 용해도 | 불용성 |
| BRN | 2107562 |
| InChI | InChI=1S/C7H4FNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | BOJWTAQWPVBIPG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 |
| NIST | 4-Fluoro-3-nitrobenzoic acid(453-71-4) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH302 (83%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (83%) |
| 수질 위해 등급(WGK) | 2 |
| 관세 코드 | 29163990 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-36-24/25 |
| 위험 등급 | IRRITANTAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Fluoro-3-nitrobenzoic acid was used:as starting reagent in the preparation of novel benzimidazoles having antimycobacterial activityin preparation of series of novel acetylcholinesterase (AChE) and butyrylcholinesterase (BChE) inhibitors containing benzimidazole core structurein preparation of bis(heterocyclic) skeletal precursors for the Pictet-Spengler reactionin solid-phase synthesis of trisubstituted [1,3,5]triazino[1,2-a]benzimidazole-2,4(3H,10H)-diones