Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Fluoropropiophenone
1-(4-fluorophenyl)propan-1-one · p-fluorophenone · Fluorophenylacetone · P-FLUOROPROPIOPHENONE · 4-FLUOROPROPIOPHENONE · LABOTEST-BB LT01148316 · 4'-fluoropropiophenone · para-Fluoropropiophenone
식별자 및 물리적 특성
| CAS No. | 456-03-1 |
|---|---|
| 분자식 | C9H9FO |
| 평균 분자량 | 152.16 g/mol |
| 단동위원소 질량 | 152.06374313 g/mol |
| SMILES | CCC(=O)c1ccc(F)cc1 |
| InChIKey | QIJNVLLXIIPXQT-UHFFFAOYSA-N |
| PubChem CID | 68004 |
| EC No. | 207-255-9 |
| DTXSID | DTXSID60196559 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 136 |
| 끓는 점 | 100-102 °C (22 mmHg) |
| 밀도 | 1.096 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.5059(lit.) |
| 인화점 | 170 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 색상 | Colorless to Light orange to Yellow |
| 비중 | 1.096 |
| BRN | 1210310 |
| InChI | InChI=1S/C9H9FO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | QIJNVLLXIIPXQT-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(F)C=C1)(=O)CC |
| NIST | 1-Propanone, 1-(4-fluorophenyl)-(456-03-1) |
화학적 성질
clear yellow liquid after melting
안전 및 규제
| GHS 분류 | DangerH302 (82%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (82%) |
| 수질 위해 등급(WGK) | 2 |
| 운송 번호(UN) | 2735 |
| 관세 코드 | 29147000 |
| 위험 문구(R) | 22-37/38-41-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-39-37/39 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |