Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Benzeneacetonitrile, 3-fluoro-
3-FLUOROBENZYL CYANIDE · m-Fluorobenzylcyanide · Vericiguat Impurity 74 · 3-FluorobenzylCyanide>M-FLUOROPHENYLACETONITRILE · 3-FLUOROPHENYLACETONITRILE · 3-fluoro-benzeneacetonitril · 3-FLUOROBENZENEACETONITRILE · Benzeneacetonitrile, 3-fluoro-
식별자 및 물리적 특성
| CAS No. | 501-00-8 |
|---|---|
| 분자식 | C8H6FN |
| 평균 분자량 | 135.14 g/mol |
| 단동위원소 질량 | 135.04842741 g/mol |
| SMILES | N#CCc1cccc(F)c1 |
| InChIKey | DEJPYROXSVVWIE-UHFFFAOYSA-N |
| PubChem CID | 68145 |
| EC No. | 207-918-2 |
| DTXSID | DTXSID4060107 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 147 |
| 녹는점 | 21 °C |
| 끓는 점 | 113-114 °C18 mm Hg(lit.) |
| 밀도 | 1.163 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.502(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | powder to lump to clear liquid |
| 색상 | White or Colorles to Yellow to Orange |
| 비중 | 1.163 |
| BRN | 1861071 |
| InChI | InChI=1S/C8H6FN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| InChIKey | DEJPYROXSVVWIE-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=CC(F)=C1 |
| NIST | Benzeneacetonitrile, 3-fluoro-(501-00-8) |
| EPA | Benzeneacetonitrile, 3-fluoro- (501-00-8) |
화학적 성질
clear light yellow to slightly brown liquid
안전 및 규제
| GHS 분류 | WarningH302 (95.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95.9%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,Xi,T |
| 안전 문구(S) | 26-37/39-24/25-36 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
| 위험 참고 사항 | Toxic |
용도
용도
3-Fluorophenylacetonitrile is a phenylacetonitrile derivative that is mainly used in pharmaceutical manufacturing or organic synthesis. It is used as a pharmaceutical intermediate for Lemborexant. The drug is a dual receptor orexin antagonist (DORA) approved for the treatment of primary insomnia.