Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-히드록시-2-메틸벤조산
4-히드록시-2-메틸벤조산 · 4-하이드록시-o-톨루산 · 4-하이드록시-2-메틸벤조산98 · 2-Methyl-4-hydroxybenzoic acid · 4-HYDROXY-2-METHYLBE · 4-hydroxy-o-toluic acid · 4-HYDROXY-2-METHYLBENZOIC ACID · 4-Hydroxy-2-methylbenzoicAcid>Benzoic acid, 4-hydroxy-2-Methyl-
식별자 및 물리적 특성
| CAS No. | 578-39-2 |
|---|---|
| 분자식 | C8H8O3 |
| 평균 분자량 | 152.15 g/mol |
| 단동위원소 질량 | 152.04734412 g/mol |
| SMILES | Cc1cc(O)ccc1C(=O)O |
| InChIKey | BBMFSGOFUHEVNP-UHFFFAOYSA-N |
| PubChem CID | 68475 |
| ChEMBL | CHEMBL4250257 |
| ChEBI | CHEBI:167791 |
| EC No. | 209-422-1 |
| DTXSID | DTXSID10206490 |
| 현지명 | 4-히드록시-2-메틸벤조산 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 57.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 155 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 177-181 °C |
| 끓는 점 | 339.1±30.0 °C(Predicted) |
| 밀도 | 1.304±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 4.46±0.25(Predicted) |
| 색상 | White to Light yellow to Light orange |
| InChI | InChI=1S/C8H8O3/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,9H,1H3,(H,10,11) |
| InChIKey | BBMFSGOFUHEVNP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(O)C=C1C |
화학적 성질
White or pink crystalline powder
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P304+P340, P305+P354+P338, P317, P319, P330, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 55 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 2 |
| 관세 코드 | 29182900 |
| 위험 문구(R) | 22-41 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-39 |
| 위험 등급 | Acute Tox. 4 OralEye Dam. 1 |
| 저장 분류 | 11 - Combustible Solids |