Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Bromoterephthalic acid
BROMOTEREPHTHALIC ACID · DK7274 · 2-BromoterephthaL · 2-BroMoterephthalic · LABOTEST-BB LT00454996 · 2-BROMOTEREPHTHALIC ACID · 2-Bromotetraphenylquinone · Bromoterephthalic Acid >2-Bromoterephthalicacid,97%
식별자 및 물리적 특성
| CAS No. | 586-35-6 |
|---|---|
| 분자식 | C8H5BrO4 |
| 평균 분자량 | 245.03 g/mol |
| 단동위원소 질량 | 243.93712074 g/mol |
| SMILES | O=C(O)c1ccc(C(=O)O)c(Br)c1 |
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| PubChem CID | 68513 |
| EC No. | 209-572-8 |
| DTXSID | DTXSID50207320 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 74.6 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 228 |
| 녹는점 | 295-297 °C(lit.) |
| 끓는 점 | 421.6±40.0 °C(Predicted) |
| 밀도 | 1.8281 (rough estimate) |
| 굴절률 | 1.4490 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 2.44±0.10(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 물에 용해됩니다. |
| BRN | 2616163 |
| InChI | InChI=1S/C8H5BrO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(C(O)=O)C=C1Br |
화학적 성질
white crystalline powder
안전 및 규제
| GHS 분류 | DangerH301 (83.3%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (83.3%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29173919 |
| 위험 문구(R) | 25-36/37/38 |
| 위험 표시 | T,C,Xi |
| 안전 문구(S) | 26-36-45-37/39 |
| 위험 등급 | 6.1Acute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
2-Bromoterephthalic acid is used as a biochemical for proteomics research. It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, dyes and agrochemicals.