Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-브로모벤질 클로라이드
2-브로모벤조일클로라이드 · 4-브로모벤질클로라이드 · 4-브로모벤질 클로라이드 · 1-Bromo-4-(chloromethyl)benzene · P-BROMOBENZYL CHLORIDE · 4-BROMOBENZYL CHLORIDE · 4-bromo-à-chlorotoluene · 4-Bromo-α-chlorotoluene
식별자 및 물리적 특성
| CAS No. | 589-17-3 |
|---|---|
| 분자식 | C7H6BrCl |
| 평균 분자량 | 205.48 g/mol |
| 단동위원소 질량 | 203.93413997 g/mol |
| SMILES | ClCc1ccc(Br)cc1 |
| InChIKey | BSIIGUGKOPPTPZ-UHFFFAOYSA-N |
| PubChem CID | 68528 |
| EC No. | 209-638-6 |
| DTXSID | DTXSID20207630 |
| 현지명 | 4-브로모벤질 클로라이드 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 77 |
| SpringerMaterials Properties | Density |
| 녹는점 | 36-40 °C |
| 끓는 점 | 136-139 °C (27 mmHg) |
| 밀도 | 1.3431 (rough estimate) |
| 굴절률 | 1.5750 (estimate) |
| 인화점 | 106-107°C/10mm |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 분말 및 과립 |
| 색상 | 하얀색 |
| 용해도 | 물에 불용성. |
| Merck | 14,1410 |
| BRN | 6123220 |
| InChI | InChI=1S/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
| InChIKey | BSIIGUGKOPPTPZ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(CCl)C=C1 |
| NIST | Benzene, 1-bromo-4-(chloromethyl)-(589-17-3) |
화학적 성질
light yellow crystal powder to light yellow liqui
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzene, 1-bromo-4-(chloromethyl)-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3261 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 36/37-34 |
| 위험 표시 | C |
| 안전 문구(S) | 45-36/37/39-25-26 |
| 포장분류 | III |
| 위험 등급 | 8Skin Corr. 1B |
| 위험 참고 사항 | Corrosive/Lachrymator |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
4-Bromobenzyl chloride is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals.