Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Bromomethyl acetate
brommethylacetat · Bromomethyl acetate,97% · Bromomethyl acetate · BROMOMETHANOLACETATE · ACETOXYMETHYLBROMIDE · bromo-methanoacetate · bromomethyl ethanoate · Bromomethyl Acetate >BroMoMethyl acetate 95%
식별자 및 물리적 특성
| CAS No. | 590-97-6 |
|---|---|
| 분자식 | C3H5BrO2 |
| 평균 분자량 | 152.97 g/mol |
| 단동위원소 질량 | 151.9472915 g/mol |
| SMILES | CC(=O)OCBr |
| InChIKey | NHYXMAKLBXBVEO-UHFFFAOYSA-N |
| PubChem CID | 68536 |
| EC No. | 209-696-2 |
| DTXSID | DTXSID00883451 |
화학 및 물리적 성질
| XLogP | 1 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 6 |
| 형식 전하 | 0 |
| 복잡도 | 52.8 |
| 녹는점 | 139-140.5 °C |
| 끓는 점 | 130-133 °C/750 mmHg (lit.) |
| 밀도 | 1.56 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.447(lit.) |
| 인화점 | 135 °F |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름과 혼합 가능. |
| 물리적 상태 | 결정성 분말 또는 분말 |
| 색상 | 흰색~밝은 베이지 |
| 안정성 | 흡습성, 수분 민감성, 휘발성 |
| InChI | InChI=1S/C3H5BrO2/c1-3(5)6-2-4/h2H2,1H3 |
| InChIKey | NHYXMAKLBXBVEO-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)Br |
| EPA | Methanol, bromo-, acetate (590-97-6) |
화학적 성질
Clear colorless to yellow liquid
안전 및 규제
| GHS 분류 | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3272 3/PG 3 |
| 관세 코드 | 29153900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-45 |
| 포장분류 | III |
| 위험 등급 | 3.2Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Bromomethyl acetate is involved in the preparation of optically active cyclohexene antisepsis agents. It acts as reagent in samarium diiodide-mediated conversion of ketones and aldehydes to 1,2-diacetates.
일반 설명
The interaction of bromomethyl acetate with O(6)-alkylguanine-DNA alkyltransferase (DNA repair protein) was studied in vitro.