Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-니트로-2-푸르알데히드(5-니트로푸르푸릴렌)히드라존
5-니트로-2-푸르알데히드(5-니트로푸르푸릴렌)히드라존 · Nifuratel-2 · Einecs 212-003-6 · 5-Nitrofuraldazine · Nifuratel impuritiesB · Nifuratel impurities481 · Nifuratel IMpurity B (5-Nitrofuraldazine) · Nifuratel Impurity 39 (5-Nitrofuraldazine)
식별자 및 물리적 특성
| CAS No. | 736-53-8 |
|---|---|
| 분자식 | C10H6N4O6 |
| 평균 분자량 | 278.18 g/mol |
| 단동위원소 질량 | 278.02873391 g/mol |
| SMILES | O=[N+]([O-])c1ccc(/C=N/N=C/c2ccc([N+](=O)[O-])o2)o1 |
| InChIKey | LIELVKLOFLWIGJ-YDWXAUTNSA-N |
| PubChem CID | 6897752 |
| ChEMBL | CHEMBL1994838 |
| DTXSID | DTXSID501036427 |
| 현지명 | 5-니트로-2-푸르알데히드(5-니트로푸르푸릴렌)히드라존 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 143 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 388 |
| 용해도 | 2.9 [ug/mL] (The mean of the results at pH 7.4) |
| 녹는점 | 240-241 °C |
| 끓는 점 | 423.0±45.0 °C(Predicted) |
| 밀도 | 1.63±0.1 g/cm3(Predicted) |
| pKa(산도 계수) | 4.17±0.50(Predicted) |
용도
용도
5-Nitrofuraldazine Nifuratel(N458250) which is a drug used as an antibacterial, antifungal, antiprotozoal (Trichomonas). Nifuratel appears to have a broad antibacterial spectrum of action and is effective against Chlamydia trachomatis and Mycoplasma spp. as well as fungal infections from Candida spp.