Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl 2-nitrobenzoate
RARECHEM AL BF 0186 · METHYL O-NITROBENZOATE · Methyl 2-nitrobenzoate · Methyl2-Nitrobenzoate>Methyl 2-nitrobenzoate 98% · Methyl 2-nitrobenzoate,99% · Methyl ortho-nitrobenzoate · Methyl2-nitrobenzoate,98+% · 2-nitro-benzoicacimethylester
식별자 및 물리적 특성
| CAS No. | 606-27-9 |
|---|---|
| 분자식 | C8H7NO4 |
| 평균 분자량 | 181.15 g/mol |
| 단동위원소 질량 | 181.0375077 g/mol |
| SMILES | COC(=O)c1ccccc1[N+](=O)[O-] |
| InChIKey | AOXPHVNMBPFOFS-UHFFFAOYSA-N |
| PubChem CID | 69072 |
| EC No. | 210-111-8 |
| DTXSID | DTXSID7060548 |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 72.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 211 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP(분배 계수) | 1.66 |
| 녹는점 | -13 °C (lit.) |
| 끓는 점 | 104-106 °C/0.1 mmHg (lit.) |
| 밀도 | 1.28 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.534(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Store at room temperature |
| 물리적 상태 | 액체 |
| 색상 | 투명한 노란색에서 주황색 갈색을 띤다. |
| BRN | 2050101 |
| 유전율 | 28.0(25℃) |
| InChI | 1S/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
| InChIKey | AOXPHVNMBPFOFS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1[N+]([O-])=O |
| EPA | Benzoic acid, 2-nitro-, methyl ester (606-27-9) |
화학적 성질
clear yellow to orange-brownish liquid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 100% (25 of 25) of all reports.Not ClassifiedAggregated GHS information provided per 25 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: Benzoic acid, 2-nitro-, methyl ester |
| Hazard Classes and Categories | Not Classified |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29163990 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Methyl 2-nitrobenzoate may be used in chemical synthesis studies.