식별자 및 물리적 특성
| CAS No. | 82821-19-0 |
|---|
| 분자식 | C13H8Cl2FN |
|---|
| 평균 분자량 | 268.11 g/mol |
|---|
| 단동위원소 질량 | 267.0017828 g/mol |
|---|
| SMILES | Fc1ccc(C=Nc2cc(Cl)cc(Cl)c2)cc1 |
|---|
| InChIKey | JANXXARWZJZKBL-UHFFFAOYSA-N |
|---|
| PubChem CID | 690809 |
|---|
| EC No. | 141-560-7 |
|---|
| DTXSID | DTXSID80351103 |
|---|
화학 및 물리적 성질
| XLogP | 4.6 |
|---|
| 극성 표면적 | 12.4 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 17 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 254 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
![Benzenamine, 3,5-dichloro-N-[(4-fluorophenyl)methylene]- 분자 구조식](/img/chemical/690809.png)