Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Ethyldiphenylphosphine
(Diphenylphosphino)ethane · NSC 151254 · 1-(Diphenylphosphi · DIPHENYLETHYLPHOSPHINE · Ethyldiphenylphosphine · Ethyl-diphenyl-phosphane · Phosphine, ethyldiphenyl- · Ethyldiphenylphosphine >Ethyldiphenylphosphine 98%
식별자 및 물리적 특성
| CAS No. | 607-01-2 |
|---|---|
| 분자식 | C14H15P |
| 평균 분자량 | 214.24 g/mol |
| 단동위원소 질량 | 214.09113711 g/mol |
| SMILES | CCP(c1ccccc1)c1ccccc1 |
| InChIKey | WUOIAOOSKMHJOV-UHFFFAOYSA-N |
| PubChem CID | 69082 |
| EC No. | 627-386-9 |
| DTXSID | DTXSID4073207 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 148 |
| 끓는 점 | 293 °C(lit.) |
| 밀도 | 1.048 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.614(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 액체 |
| 색상 | 무색의 |
| 비중 | 1.048 |
| BRN | 744253 |
| InChI | InChI=1S/C14H15P/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | WUOIAOOSKMHJOV-UHFFFAOYSA-N |
| SMILES | P(CC)(C1=CC=CC=C1)C1=CC=CC=C1 |
| EPA | Phosphine, ethyldiphenyl- (607-01-2) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | SY9242500 |
| 운송 번호(UN) | 3278 |
| 관세 코드 | 29310099 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-36 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 10-13-23 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Catalyst for:Three component coupling reactions of arylaldehydes with Me vinyl ketone and phthalimideRegio- and stereoselective hydroalkynylation of methylenecyclopropanesSynthesis of oxazolidines, thiazolidines, pyrrolidines, and indolesDimer to monomer conversionTandem Morita-Baylis-Hillman/Michael addition reactionsPlatinum-catalyzed cyclizationRegioselective and stereoselective [3+2] cycloadditionPlatinum-catalyzed intermolecular hydroaminationHydroformylation reactions