Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-Nitroisoquinoline
NSC 3017 · 5-NITROISOQUINOLINE · Isoquinoline,5-nitro- · 5-Nitroisoquinoline 98% · 5-Nitroisoquinoline?New · 5-Nitroisoquinoline, 98+% · 5-Nitroisoquinoline98%Or99% · 5-Nitroisoquinoline, 98% 10GR
식별자 및 물리적 특성
| CAS No. | 607-32-9 |
|---|---|
| 분자식 | C9H6N2O2 |
| 평균 분자량 | 174.16 g/mol |
| 단동위원소 질량 | 174.04292743 g/mol |
| SMILES | O=[N+]([O-])c1cccc2cnccc12 |
| InChIKey | PYGMPFQCCWBTJQ-UHFFFAOYSA-N |
| PubChem CID | 69085 |
| ChEMBL | CHEMBL353253 |
| EC No. | 210-133-8 |
| DTXSID | DTXSID00209511 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 58.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 202 |
| SpringerMaterials Properties | Chemical shift |
| 녹는점 | 106-109 °C (lit.) |
| 끓는 점 | 305.12°C (rough estimate) |
| 밀도 | 1.3146 (rough estimate) |
| 굴절률 | 1.5651 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 3.55±0.13(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | Light yellow to Amber to Dark green |
| BRN | 134858 |
| InChI | 1S/C9H6N2O2/c12-11(13)9-3-1-2-7-6-10-5-4-8(7)9/h1-6H |
| InChIKey | PYGMPFQCCWBTJQ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc2cnccc12 |
화학적 성질
light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29334900 |
| 위험 문구(R) | 36/37/38-38-20/21/22-40 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-37/39-36/37/39-36-22 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
5-Nitroisoquinoline (cas# 607-32-9) is a compound useful in organic synthesis.
일반 설명
5-Nitroisoquinoline reacted with vinylmagnesium bromide to form a number of pyrroloisoquinolines. 5-Nitroisoquinoline derivatives (potential antimalarial drugs) were evaluated for mutagenic (MUT) and chromosome-damaging (CHR) activities by the Salmonella test.