Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Diethyl 2-benzylpropanedioate
Diethyl 2-benzylmalonate · NSC 8720 · NSC 41169 · NSC 631631 · AKOS BBS-00006590 · Diethyl benzylmalote · DIETHYL BENZYLMALONATE · Racecadotril Impurity K
식별자 및 물리적 특성
| CAS No. | 607-81-8 |
|---|---|
| 분자식 | C14H18O4 |
| 평균 분자량 | 250.29 g/mol |
| 단동위원소 질량 | 250.12050906 g/mol |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)OCC |
| InChIKey | ICZLTZWATFXDLP-UHFFFAOYSA-N |
| PubChem CID | 69090 |
| EC No. | 210-142-7 |
| DTXSID | DTXSID4022078 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 52.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 251 |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| LogP(분배 계수) | 2.76 |
| 끓는 점 | 162-163 °C/10 mmHg (lit.) |
| 밀도 | 1.064 g/mL at 25 °C (lit.) |
| 증기압 | 0.26Pa at 25℃ |
| 굴절률 | n20/D 1.486(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름, 메탄올에 용해됨 |
| pKa(산도 계수) | 12.56±0.46(Predicted) |
| 물리적 상태 | 무색 액체 |
| 색상 | 무색 내지 거의 무색 |
| 용해도 | 섞일 수 없음 |
| BRN | 615793 |
| InChI | 1S/C14H18O4/c1-3-17-13(15)12(14(16)18-4-2)10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | ICZLTZWATFXDLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)OCC |
| LogP(분배 계수) | 2.76 |
| NIST | Propanedioic acid, (phenylmethyl)-, diethyl ester(607-81-8) |
| EPA | Propanedioic acid, 2-(phenylmethyl)-, 1,3-diethyl ester (607-81-8) |
화학적 성질
Colourless Liquid
안전 및 규제
| GHS 분류 | WarningH315 (25%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Propanedioic acid, (phenylmethyl)-, diethyl esterStatus: Active Update: 17-01-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/16822Propanedioic acid, (phenylmethyl)-, diethyl ester: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Aquatic Chronic 2 (25%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29173980 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25-36-26 |
| 위험 등급 | Aquatic Chronic 2 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Diethyl Benzylmalonate (cas# 607-81-8) is a compound useful in organic synthesis.
일반 설명
Diethyl benzylmalonate on condensation with 2-amino-benzimidazole yields 3-benzyl-4-hydroxypyrimido[1,2-a]benzimidazole-2-one.