Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-메틸-o-톨루이딘
N,2-다이메틸아닐린 · N-메틸-o-톨루이딘 · N-메틸-o-톨루이딘(N-METHYL-o-TOLUIDINE) · N,2-DIMETHYLANILINE · NSC 9395 · N-Methyl-o-t · 2,N-Dimethylaniline · N-Methyl-o-touidine
식별자 및 물리적 특성
| CAS No. | 611-21-2 |
|---|---|
| 분자식 | C8H11N |
| 평균 분자량 | 121.18 g/mol |
| 단동위원소 질량 | 121.08914935 g/mol |
| SMILES | CNc1ccccc1C |
| InChIKey | GUAWMXYQZKVRCW-UHFFFAOYSA-N |
| PubChem CID | 69137 |
| EC No. | 210-260-9 |
| DTXSID | DTXSID4060600 |
| 현지명 | N-메틸-o-톨루이딘 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 12 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 80.6 |
| SpringerMaterials Properties | Optical coefficient |
| LogP(분배 계수) | 2.16 |
| 녹는점 | -10.08°C (estimate) |
| 끓는 점 | 207 °C |
| 밀도 | 0.97 |
| 굴절률 | 1.562-1.565 |
| 인화점 | 79.4 °C |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 물에 거의 녹지 않음 |
| 물리적 상태 | 투명한 액체 |
| pKa(산도 계수) | 4.72±0.10(Predicted) |
| 색상 | White to Yellow to Green |
| InChI | InChI=1S/C8H11N/c1-7-5-3-4-6-8(7)9-2/h3-6,9H,1-2H3 |
| InChIKey | GUAWMXYQZKVRCW-UHFFFAOYSA-N |
| SMILES | C1(NC)=CC=CC=C1C |
| EPA | Benzenamine, N,2-dimethyl- (611-21-2) |
화학적 성질
Clear liquid, darkening on storage
안전 및 규제
| GHS 분류 | DangerH301: Toxic if swallowed [Danger Acute toxicity, oral]P260, P261, P262, P264, P270, P271, P273, P280, P301+P316, P302+P352, P304+P340, P316, P319, P321, P330, P361+P364, P403+P233, P405, and P501 (click each P-code to see the statement)H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%)Acute toxicity - category 3Acute Tox. 3 * |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 1711 |
| 관세 코드 | 2921490090 |
| 위험 문구(R) | 52/53-33-23/24/25 |
| 위험 표시 | T |
| 안전 문구(S) | 61-45-36/37-28A-28 |
| 포장분류 | II |
| 위험 등급 | 6.1(a)Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 3 OralAquatic Chronic 3STOT RE 2 |
| 기존화학 물질 | KE-25368 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| 함량 및 규제정보 | 물질구분: 유독물질혼합물(제품)함량정보: N-알킬 톨루이딘과 그 염류 및 이를 25% 이상 함유한 혼합물 |
| 유해화학물질 필터링 | 97-1-451 |
용도
용도
Reactant for:Palladium-catalyzed coupling reactionsPalladium-catalyzed amination of bromoindazoles
일반 설명
N-Methyl-o-toluidine can be synthesized by reacting o-toluidine and benzotriazole.