Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Benzoylbenzoic acid
4-BENZOYLBENZOIC ACID · Benzoic acid, 4-benzoyl- · P-BROMOBENZHYDROL · 4-benzoylbenzoate · 4-Bromobenzhydrol · Benzoylbenzoicacid · RARECHEM AL BO 0331 · P-BENZOYLBENZOIC ACID
식별자 및 물리적 특성
| CAS No. | 611-95-0 |
|---|---|
| 분자식 | C14H10O3 |
| 평균 분자량 | 226.23 g/mol |
| 단동위원소 질량 | 226.06299418 g/mol |
| SMILES | O=C(O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChIKey | IFQUPKAISSPFTE-UHFFFAOYSA-N |
| PubChem CID | 69147 |
| ChEMBL | CHEMBL192648 |
| EC No. | 210-286-0 |
| DTXSID | DTXSID60209996 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 54.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 284 |
| 녹는점 | 198-200 °C (lit.) |
| 끓는 점 | 327.84°C (rough estimate) |
| 밀도 | 1.2022 (rough estimate) |
| 굴절률 | 1.5767 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 3.79±0.10(Predicted) |
| 색상 | 흰색~밝은 베이지 |
| 용해도 | 물에 부분적으로 용해됩니다. |
| BRN | 1960224 |
| 안정성 | 안정적인. 강염기, 강산화제와 호환되지 않습니다. |
| InChI | InChI=1S/C14H10O3/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17/h1-9H,(H,16,17) |
| InChIKey | IFQUPKAISSPFTE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C(=O)C2=CC=CC=C2)C=C1 |
화학적 성질
white crystalline solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzoic acid, 4-benzoyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DG3650000 |
| 관세 코드 | 29145090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-36-26-37/39 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Benzoylbenzoic acid,is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field etc.
일반 설명
4-Benzoylbenzoic acid is a benzophenone derivative. It can undergo hydrogenolysis to 4-benzylbenzoic acid. Cotton fabrics incorporated with 4-benzoylbenzoic acid have shown pesticide degradation ability, when exposed to UV irradiation.