Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4,4'-Dimethylbenzophenone
Di-p-tolylmethanone · SKL272 · p-Tolyl ketone · DI-P-TOLYL KETONE · Bis-p-tolyl ketone · 4,4'-Dimethylbenzoph · Di(4-methylphenyl) ketone · 4,4'-Carbonylbis(toluene)
식별자 및 물리적 특성
| CAS No. | 611-97-2 |
|---|---|
| 분자식 | C15H14O |
| 평균 분자량 | 210.27 g/mol |
| 단동위원소 질량 | 210.10446507 g/mol |
| SMILES | Cc1ccc(C(=O)c2ccc(C)cc2)cc1 |
| InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| PubChem CID | 69148 |
| ChEMBL | CHEMBL1490173 |
| EC No. | 210-287-6 |
| DTXSID | DTXSID9060603 |
화학 및 물리적 성질
| XLogP | 3.6 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 206 |
| 녹는점 | 90-93 °C(lit.) |
| 끓는 점 | 200 °C17 mm Hg(lit.) |
| 밀도 | 1.0232 (rough estimate) |
| 굴절률 | 1.5361 (estimate) |
| 인화점 | 200°C/17mm |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| 색상 | 옅은 갈색 |
| 용해도 | 물에 불용성. |
| BRN | 1240527 |
| InChI | InChI=1S/C15H14O/c1-11-3-7-13(8-4-11)15(16)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)=O |
| NIST | 4,4'-Dimethyl benzophenone(611-97-2) |
| EPA | Methanone, bis(4-methylphenyl)- (611-97-2) |
화학적 성질
Pale brown crystalline powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29143990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-36/37-26 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4,4'-Dimethylbenzophenone is used as catalytic agent and petrochemical additive. It is also used as pharmaceutical intermediates.
일반 설명
4,4′-Dimethylbenzophenone reacts with bis(trichlorotitanium phenoxide), a bidentate Lewis acid, to form a crystalline complex.