Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-히드록시-4-니트로벤조산
3-히드록시-4-니트로벤조산 · 3-하이드록시-4-나이트로벤조산 · 4-NITRO-3-HYDROXYBENZOIC ACID · 3H 4N BA · C7H5NO5 · RARECHEM AL BE 0673 · Tafamidis Impurity 1 · 4-nitro-3-oxidobenzoate
식별자 및 물리적 특성
| CAS No. | 619-14-7 |
|---|---|
| 분자식 | C7H5NO5 |
| 평균 분자량 | 183.12 g/mol |
| 단동위원소 질량 | 183.01677226 g/mol |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| PubChem CID | 69265 |
| EC No. | 210-580-9 |
| DTXSID | DTXSID20210922 |
| 현지명 | 3-히드록시-4-니트로벤조산 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 103 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 223 |
| LogP(분배 계수) | 1.98 |
| 녹는점 | 229-231 °C (lit.) |
| 끓는 점 | 316.77°C (rough estimate) |
| 밀도 | 1.6074 (rough estimate) |
| 굴절률 | 1.6280 (estimate) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 1.08g/l(계산) |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 3.30±0.10(Predicted) |
| 색상 | 노란색에서 갈색으로 |
| 용해도 | 불용성 |
| BRN | 2107564 |
| InChI | InChI=1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C(O)=C1 |
| NIST | 3-Hydroxy-4-nitrobenzoic acid(619-14-7) |
화학적 성질
yellow to brownish powder
안전 및 규제
| GHS 분류 | WarningH302 (15.9%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P261, P264, P264+P265, P270, P271, P272, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P318, P319, P321, P330, P332+P317, P333+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 63 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzoic acid, 3-hydroxy-4-nitro-Status: Active Update: 27-08-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/26644 |
| Hazard Classes and Categories | Acute Tox. 4 (15.9%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29182990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Hydroxy-4-nitrobenzoic acid is a compound that is capable of inhibiting chloroplast development in linseed and oat seedlings. 3-Hydroxy-4-nitrobenzoic acid also exhibits inhibitory effects on Ras proteins, making them potentially useful compounds in treating cancer.