Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-히드록시-4-니트로벤조산
2-히드록시-4-니트로벤조산 · 4-나이트로살리실산 · 2-HYDROXY-4-NITROBENZOIC ACID · 4-nitro-salicylsaure · 4-nitro-salicylicaci · 4-NITROSALICYLIC ACID · P-NITRO SALICYLIC ACID · 4-NitrosalicylicAcid>2-Hydroxy-nitrobenzoic acid
식별자 및 물리적 특성
| CAS No. | 619-19-2 |
|---|---|
| 분자식 | C7H5NO5 |
| 평균 분자량 | 183.12 g/mol |
| 단동위원소 질량 | 183.01677226 g/mol |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1O |
| InChIKey | UKWUOTZGXIZAJC-UHFFFAOYSA-N |
| PubChem CID | 69266 |
| ChEMBL | CHEMBL4062583 |
| EC No. | 210-584-0 |
| DTXSID | DTXSID5060695 |
| 현지명 | 2-히드록시-4-니트로벤조산 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 103 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 223 |
| 녹는점 | 235-239 °C (lit.) |
| 끓는 점 | 316.77°C (rough estimate) |
| 밀도 | 1.6074 (rough estimate) |
| 굴절률 | 1.6280 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 2.11±0.13(Predicted) |
| 물리적 상태 | 고체 또는 결정성 분말 |
| 색상 | 흰색에서 옅은 갈색까지 |
| InChI | InChI=1S/C7H5NO5/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | UKWUOTZGXIZAJC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1O |
| EPA | Benzoic acid, 2-hydroxy-4-nitro- (619-19-2) |
화학적 성질
White to yellow crystalline powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 2.3% (1 of 44) of reports.WarningH302 (95.5%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95.5%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | VO5300100 |
| 독성 | LD50 orl-mus: 650 mg/kg ZNTFA2 6B,183,51 |
| 관세 코드 | 29182900 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-36 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Nitrosalicylic Acid is a metabolite in the degradation pathway of 2-chloro-4-nitrobenzoic acid by acinetobacter strain RKJ12.
일반 설명
2-Hydroxy-4-nitrobenzoic acid is metabolized to 2,4-dihydroxybenzoic acid (2,4-DHBA) by a mono-oxygenase with the concomitant release of chloride and nitrite ions.