Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Amino-3-chloropyridine
3-CHLOROPYRIDIN-2-AMINE · AURORA 15088 · IFLAB-BB F3099-7175 · OTAVA-BB BB7110951381 · Pyridinamine, 3-chloro · 3-Choro-2-pyridinamine · 2-AMino-3-chloropyridi · Amino-3-Chloropyridine
식별자 및 물리적 특성
| CAS No. | 39620-04-7 |
|---|---|
| 분자식 | C5H5ClN2 |
| 평균 분자량 | 128.56 g/mol |
| 단동위원소 질량 | 128.01412584 g/mol |
| SMILES | Nc1ncccc1Cl |
| InChIKey | RZJPBQGRCNJYBU-UHFFFAOYSA-N |
| PubChem CID | 693267 |
| EC No. | 678-697-1 |
| DTXSID | DTXSID20351203 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 38.9 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 76.8 |
| 녹는점 | 59-62℃ |
| 끓는 점 | 207.0±20.0 °C(Predicted) |
| 밀도 | 1.326±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 4.14±0.36(Predicted) |
| 색상 | White to Orange to Green |
| InChI | InChI=1S/C5H5ClN2/c6-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8) |
| InChIKey | RZJPBQGRCNJYBU-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1Cl |
화학적 성질
Light green solid
안전 및 규제
| GHS 분류 | DangerH302 (97.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.9%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38-41-37/38-22-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36/37/39-39-36/37-24/25 |
| 위험 등급 | IRRITANTAcute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |