Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디에틸디브로모말로네이트
디에틸디브로모말로네이트 · Ethyl dibromomalonate · Diethyl dibromomalonate · Diethyldibromomalonate,98% · Diethyl dibromomalonate 97% · Diethyl 2,2-dibromomalonate · iethyl2,2-dibromopropanedioate · diethyl 2,2-dibromopropanedioate
식별자 및 물리적 특성
| CAS No. | 631-22-1 |
|---|---|
| 분자식 | C7H10Br2O4 |
| 평균 분자량 | 317.96 g/mol |
| 단동위원소 질량 | 315.894583 g/mol |
| SMILES | CCOC(=O)C(Br)(Br)C(=O)OCC |
| InChIKey | PFZYFZRUPFUEOB-UHFFFAOYSA-N |
| PubChem CID | 69427 |
| EC No. | 211-151-9 |
| DTXSID | DTXSID6060890 |
| 현지명 | 디에틸디브로모말로네이트 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 52.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 183 |
| 끓는 점 | 140-143 °C/18 mmHg (lit.) |
| 밀도 | 1.68 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.484(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | sol benzene, CCl4, DMSO, THF |
| 물리적 상태 | 액체 |
| 색상 | 투명하고 연한 노란색 |
| BRN | 1783879 |
| InChI | InChI=1S/C7H10Br2O4/c1-3-12-5(10)7(8,9)6(11)13-4-2/h3-4H2,1-2H3 |
| InChIKey | PFZYFZRUPFUEOB-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Br)(Br)C(OCC)=O |
| EPA | Propanedioic acid, dibromo-, diethyl ester (631-22-1) |
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 1760 |
| 관세 코드 | 29171900 |
| 위험 문구(R) | 34 |
| 안전 문구(S) | 20-26-36/37/39-45-60 |
| 포장분류 | III |
| 위험 등급 | 8 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Diethyl dibromomalonate is used for selective bromination of polyunsaturated ester enolates; converts alkenes into cyclopropanes in the presence of suitable heavy metal reagents.
일반 설명
Diethyl dibromomalonate reacts with sodium methoxide in cyclohexene to afford dibromonorcarane. It also reacts with allyl(pyridine)cobaloximes to afford the corresponding allyl-substituted esters.