Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-4-methylquinoline
2-CHLORO-4-METHYLQUINOLINE · AKOS BB-6898 · Chlorolepidine · 3-chlorolepidine · 2-Chlorolepidine · AKOS BBS-00000215 · Lepidine, 2-chloro- · 2-Chlorolepidine >OTAVA-BB BB0116110026
식별자 및 물리적 특성
| CAS No. | 634-47-9 |
|---|---|
| 분자식 | C10H8ClN |
| 평균 분자량 | 177.63 g/mol |
| 단동위원소 질량 | 177.03452694 g/mol |
| SMILES | Cc1cc(Cl)nc2ccccc12 |
| InChIKey | PFEIMKNQOIFKSW-UHFFFAOYSA-N |
| PubChem CID | 69449 |
| EC No. | 211-209-3 |
| DTXSID | DTXSID00212808 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 12.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 160 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 55-58 °C(lit.) |
| 끓는 점 | 296 °C(lit.) |
| 밀도 | 1.1810 (rough estimate) |
| 굴절률 | 1.6224 (estimate) |
| 인화점 | 296°C |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 0.98±0.50(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 118333 |
| InChI | InChI=1S/C10H8ClN/c1-7-6-10(11)12-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| InChIKey | PFEIMKNQOIFKSW-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C)=CC=1Cl |
| NIST | Quinoline, 2-chloro-4-methyl-(634-47-9) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29334900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-36-24/25 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
2-Chloro-4-methyl-quinoline is a useful synthetic intermediate. It is an intermediate used to synthesize 4-Methyl-2-(1-piperidinyl)-quinoline (M320715) which is a potent inhibitor of TRPC4 channels, responsible for various stimulation, muscle response due to interaction with the environment. 2-Chloro-4-methyl-quinoline is also considered as a cyanine dye.