Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Acetic acid, azido-, ethyl ester
ethyl 2-azidoacetate · azidoacetate · azido-aceticaciethylester · DDYSYZ · ETHYL AZIDOACET · ETHYLAZIDACETATE · ETHYL AZIDOACETATE · Ethyl azidacetate 97%
식별자 및 물리적 특성
| CAS No. | 637-81-0 |
|---|---|
| 분자식 | C4H7N3O2 |
| 평균 분자량 | 129.12 g/mol |
| 단동위원소 질량 | 129.05382646 g/mol |
| SMILES | CCOC(=O)CN=[N+]=[N-] |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| PubChem CID | 69480 |
| EC No. | 211-301-3 |
| DTXSID | DTXSID30213101 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 40.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 139 |
| 끓는 점 | 44-46°C 2mm |
| 밀도 | 1.12g/ml |
| 굴절률 | 1.4330 to 1.4370 |
| 인화점 | 25 °C |
| 저장 조건 | Refrigerator, under inert atmosphere |
| 용해도 | 클로로포름(적게), 에틸아세테이트(약간)에 용해됨 |
| 물리적 상태 | 기름 |
| 색상 | 무색~담황색 |
| BRN | 4247209 |
| InChI | InChI=1S/C4H7N3O2/c1-2-9-4(8)3-6-7-5/h2-3H2,1H3 |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| SMILES | C(=O)(OCC)CN=[N+]=[N-] |
안전 및 규제
| GHS 분류 | WarningH226 (90.5%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 21 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (90.5%) |
| 수질 위해 등급(WGK) | 2 |
| 운송 번호(UN) | UN 1593 6.1/PG 3 |
| 관세 코드 | 2929.90.5090 |
| 위험 문구(R) | 1-40-36/37/38-10-67-65-63-48/20-38-11 |
| 위험 표시 | Xn,Xi,C,F |
| 안전 문구(S) | 7-16-26-35-36-47-62-45-36/37 |
| 포장분류 | III |
| 위험 등급 | 3Eye Irrit. 2Flam. Liq. 2 |
| 위험 참고 사항 | Irritant/Corrosive |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Ethyl Azidoacetate is an important organic substance that can undergo cyclisation reactions and is commonly used in the field of chemical synthesis.The condensation of 1-methyl-β-carboline-3-carbaldehyde with ethyl azidoacetate can be used to prepare 2-formylxanthine derivatives[1].