Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,5-디클로로-3-니트로벤조산
2,5-디클로로-3-니트로벤조산 · DINOBEN · TIMTEC-BB SBB003246 · 2,5-Dichloro-3-nitro · 2,5-dichloro-3-nitrobenzoic · 2,5-DICHLORO-3-NITROBENZOIC ACID · 3-nitro-2,5-dichlorobenzoic acid · Benzoic acid, 2,5-dichloro-3-nitro-
식별자 및 물리적 특성
| CAS No. | 88-86-8 |
|---|---|
| 분자식 | C7H3Cl2NO4 |
| 평균 분자량 | 236.01 g/mol |
| 단동위원소 질량 | 234.94391294 g/mol |
| SMILES | O=C(O)c1cc(Cl)cc([N+](=O)[O-])c1Cl |
| InChIKey | AUAXYMOBWXOEQD-UHFFFAOYSA-N |
| PubChem CID | 6951 |
| ChEMBL | CHEMBL2260701 |
| EC No. | 201-862-2 |
| DTXSID | DTXSID3041372 |
| 현지명 | 2,5-디클로로-3-니트로벤조산 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 255 |
| 녹는점 | 216-220 °C (lit.) |
| 끓는 점 | 366.5±42.0 °C(Predicted) |
| 밀도 | 1.713±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 1.56±0.20(Predicted) |
| BRN | 1976119 |
| InChI | 1S/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| InChIKey | AUAXYMOBWXOEQD-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(Cl)cc(c1Cl)[N+]([O-])=O |
| EPA | 2,5-Dichloro-3-nitrobenzoic acid (88-86-8) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | DG7875000 |
| 관세 코드 | 2916399090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2,5-Dichloro-3-nitrobenzoic Acid is used in process for the preparation of organic halides.
일반 설명
Effect of 2,5-dichloro-3-nitrobenzoic acid on growth and on polar auxin transport has been studied.