펜타플로로스티렌
2,3,4,5,6-펜타플루오로스타이렌 · 펜타플로로스티렌 · PENTAFLUOROSTYRENE · 1,2,3,4,5-Pentafluoro-6-vinylbenzene · Vinylpentafluorobenzene · 1-(Pentafluorophenyl)ethene · 2,3,4,5,6-PENTAFLUOROSTYRENE · Styrene, 2,3,4,5,6-pentafluoro-
식별자 및 물리적 특성
| CAS No. | 653-34-9 |
|---|---|
| 분자식 | C8H3F5 |
| 평균 분자량 | 194.1 g/mol |
| 단동위원소 질량 | 194.01549091 g/mol |
| SMILES | C=Cc1c(F)c(F)c(F)c(F)c1F |
| InChIKey | LVJZCPNIJXVIAT-UHFFFAOYSA-N |
| PubChem CID | 69556 |
| EC No. | 211-500-5 |
| DTXSID | DTXSID30215645 |
| 현지명 | 펜타플로로스티렌 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 179 |
| 끓는 점 | 62-63 °C/50 mmHg (lit.) |
| 밀도 | 1.406 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.446(lit.) |
| 인화점 | 94 °F |
| 저장 조건 | -20°C |
| 물리적 상태 | 액체 |
| 비중 | 1.432 |
| 색상 | 무색~황색으로 투명함 |
| 용해도 | 물과 섞이지 않습니다. |
| BRN | 1874390 |
| 안정성 | 가연성. 강한 산화제와 호환되지 않습니다. |
| InChI | InChI=1S/C8H3F5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
| InChIKey | LVJZCPNIJXVIAT-UHFFFAOYSA-N |
| SMILES | C1(C=C)=C(F)C(F)=C(F)C(F)=C1F |
화학적 성질
colourless liquid
안전 및 규제
| GHS 분류 | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1993 3/PG 3 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 10 |
| 위험 표시 | F |
| 안전 문구(S) | 23-24/25-16 |
| 포장분류 | III |
| 위험 등급 | 3Flam. Liq. 3 |
| 위험 참고 사항 | Flammable/Keep Cold |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
2,3,4,5,6-Pentafluorostyrene is used in the synthesis of optically active copolymers having low surface energies by utilizing beta-pinene as another monomer. It is also used in the synthesis of fluorinated and photo crosslinkable liquid prepolymers, which is used for flexible optical waveguides. Polymeric fluorinated nano particles prepared using 2,3,4,5,6-Pentafluorostyrene and styrene is explored in magnetic resonance image (MRI) applications, since it has larger structural design potential compared to traditional systems like emulsions and solutions of smaller molecules.
일반 설명
2,3,4,5,6-Pentafluorostyrene is a fluorinated monomer.