Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Nitro-2-(trifluoromethyl)anisole
LABOTEST-BB LT00848189 · 2-Trifluoromethyl-4-nitroanisole · 5-Nitro-2-methoxybenzotrifluoride · 2-methoxy-5-nitrotrifluorotoluene · 2-Methoxy-5-nitrobenzotrifluoride · 4-NITRO-2-(TRIFLUOROMETHYL)ANISOLE · 2-Methoxy-5-nitrobenzotrifluoride99% · 2-Methoxy-5-nitrobenzotrifluoride 99%
식별자 및 물리적 특성
| CAS No. | 654-76-2 |
|---|---|
| 분자식 | C8H6F3NO3 |
| 평균 분자량 | 221.13 g/mol |
| 단동위원소 질량 | 221.02997771 g/mol |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChIKey | KGFADEJSZXEVMC-UHFFFAOYSA-N |
| PubChem CID | 69562 |
| EC No. | 211-507-3 |
| DTXSID | DTXSID40215712 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 55.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 238 |
| 녹는점 | 79-81 °C(lit.) |
| 끓는 점 | 267.2±40.0 °C(Predicted) |
| 밀도 | 1.392±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| BRN | 2129987 |
화학적 성질
white to light yellow crystal powder.
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1759 8/PG 2 |
| 관세 코드 | 2918290090 |
| 위험 문구(R) | 34 |
| 위험 표시 | C,Xi |
| 안전 문구(S) | 26-27-28-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8 |
| 위험 참고 사항 | Irritant |