Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-6-fluorobenzonitrile
AKOS BBS-00006480 · LABOTEST-BB LT00159627 · 2-Chlor-6-fluorbenzonitril · 6-Chloro-2-Fluorobenzonitrile · 2-CHLORO-6-FLUOROBENZONITRILE · 2-Chloro-6-fluorocyanobenzene · 6-Fluoro-2-chlorobenzonitrile · 2-Fluoro-6-Chlorobenzonitrile
식별자 및 물리적 특성
| CAS No. | 668-45-1 |
|---|---|
| 분자식 | C7H3ClFN |
| 평균 분자량 | 155.55 g/mol |
| 단동위원소 질량 | 154.993805 g/mol |
| SMILES | N#Cc1c(F)cccc1Cl |
| InChIKey | XPTAYRHLHAFUOS-UHFFFAOYSA-N |
| PubChem CID | 69587 |
| EC No. | 211-571-2 |
| DTXSID | DTXSID70216919 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 162 |
| 물질 분류 | Nitrogen Compounds -> Nitriles |
| Physical Description | Crystalline powder[MSDSonline] |
| 녹는점 | 55-59 °C(lit.) |
| 끓는 점 | 104 °C11 mm Hg(lit.) |
| 밀도 | 1.3760 (estimate) |
| 인화점 | 104-105°C/11mm |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 물에 불용성 |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 밝은 노란색 |
| BRN | 1940332 |
| InChI | InChI=1S/C7H3ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | XPTAYRHLHAFUOS-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(F)C=CC=C1Cl |
화학적 성질
colourless to light beige crystals, crystalline
안전 및 규제
| GHS 분류 | DangerH302 (95.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzonitrile, 2-chloro-6-fluoro- |
| 유해성 요약 | An irritant[MSDSonline] See NITRILES. |
| Hazard Classes and Categories | Acute Tox. 4 (95.7%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3439 6.1/PG 3 |
| 관세 코드 | 29269095 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,T,Xi |
| 안전 문구(S) | 26-37/39-36/37/39-36 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Toxic |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Chloro-6-fluorobenzonitrile was used in the synthesis of:rac-2-chloro-6-(oxiran-2-ylmethoxy)benzonitrilehigh-molecular-weight, soluble polyarylether alternating copolymers containing pendent cyano groups
일반 설명
2-Chloro-6-fluorobenzonitrile is an inhibitor of cellulose synthesis.