Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-메틸-비스(트리플루오로아세트아미드)
N-메틸-비스(트리플루오로아세트아미드) · MBTFA · N-Methylbis(Tr · [Trifluoroacylating Agent] · Florists Sendranthema Extract · N-Methylbistrifluororacetamide · N-METHYLBIS(TRIFLUOROACETAMIDE) · N-Methylbis(trifluoroacetyl)amine
식별자 및 물리적 특성
| CAS No. | 685-27-8 |
|---|---|
| 분자식 | C5H3F6NO2 |
| 평균 분자량 | 223.07 g/mol |
| 단동위원소 질량 | 223.00679731 g/mol |
| SMILES | CN(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChIKey | AWGBWLXGUPTXHF-UHFFFAOYSA-N |
| PubChem CID | 69635 |
| EC No. | 211-680-5 |
| DTXSID | DTXSID00218623 |
| 현지명 | N-메틸-비스(트리플루오로아세트아미드) |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 37.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 228 |
| 물질 분류 | Nitrogen Compounds -> Other Nitrogen Compounds |
| SpringerMaterials Properties | 19F nuclear magnetic resonance spectrum |
| Physical Description | Clear colorless liquid[Sigma-Aldrich MSDS] |
| 끓는 점 | 121-122 °C(lit.) |
| 밀도 | 1.547 g/mL at 25 °C |
| 굴절률 | n20/D 1.346(lit.) |
| 인화점 | 42 °C |
| 저장 조건 | 2-8°C |
| pKa(산도 계수) | -3.38±0.70(Predicted) |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색~연황색 |
| 비중 | 1.547 |
| BRN | 1878402 |
| InChI | 1S/C5H3F6NO2/c1-12(2(13)4(6,7)8)3(14)5(9,10)11/h1H3 |
| InChIKey | AWGBWLXGUPTXHF-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| NIST | Acetamide, 2,2,2-trifluoro-n-methyl-n-(trifluoroacetyl)-(685-27-8) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | 2,2,2-Trifluoro-N-methyl-N-(trifluoroacetyl)acetamide: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Causes burnsInhalation may cause corrosive injuries to upper respiratory tract and lungs[Sigma-Aldrich MSDS] See Fluoroacetamide. See Chloroacetamide. |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2920 8/PG 2 |
| 관세 코드 | 29241990 |
| 위험 문구(R) | 10-34-44 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-16 |
| 포장분류 | II |
| 위험 등급 | 8Flam. Liq. 3Skin Corr. 1B |
| F 고인화성물질 | 10-21 |
| 위험 참고 사항 | Corrosive/Moisture Sensitive |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Reagent for introducing trifluoroacetyl group.