파이로멜리틱 디안하이드리드
파이로멜리틱디안하이드리드 · 파이로멜리틱이무수물 · 피로MELLITIC디무수물 · 무수피로멜리트산 · 피로멜리트산이무수물 · 1,2,4,5-벤젠테트라카복실산 무수물 · 1H,3H-벤조[1,2-c:4,5-c']다이퓨란-1,3,5,7-테트라온 · 1H,3H-벤졸(1,2-C:4,5-C')다이퓨란-1,3,5,7-테트라온
식별자 및 물리적 특성
| CAS No. | 89-32-7 |
|---|---|
| 분자식 | C10H2O6 |
| 평균 분자량 | 218.12 g/mol |
| 단동위원소 질량 | 217.98513778 g/mol |
| SMILES | O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| InChIKey | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| PubChem CID | 6966 |
| ChEMBL | CHEMBL3182140 |
| EC No. | 201-898-9 |
| DTXSID | DTXSID1026536 |
| 현지명 | 파이로멜리틱 디안하이드리드 |
화학 및 물리적 성질
| XLogP | 0.7 |
|---|---|
| 극성 표면적 | 86.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 349 |
| 녹는점 | 283-286 °C(lit.) |
| 끓는 점 | 397-400 °C(lit.) |
| 밀도 | 1,68 g/cm3 |
| 증기압 | 0Pa at 25℃ |
| 굴절률 | 1.6000 (estimate) |
| 인화점 | 380 °C |
| 저장 조건 | 2-30°C |
| 용해도 | 디메틸 설폭사이드, 에 용해됨아세톤, 에 용해됨클로로포름, 에틸 에테르, n-헥산 및 벤젠에 용해됩니다. |
| 물리적 상태 | 고운 가루 |
| pKa(산도 계수) | 5.45[at 20 ℃] |
| 색상 | 흰색에서 연한 노란색 |
| 용해도 | 물에서 분해되다 |
| BRN | 213583 |
| 헨리 상수 | 1.3×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C10H2O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-2H |
| InChIKey | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc3C(=O)OC(=O)c3cc12 |
| LogP(분배 계수) | -2.03 at 21.5℃ |
| NIST | 1,2,4,5-Benzenetetracarboxylic anhydride(89-32-7) |
| EPA | 1H,3H-Benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone (89-32-7) |
화학적 성질
White powder. Soluble in some organic solvents; hydrolyzes to the acid when exposed to moisture.
안전 및 규제
| 수질 위해 등급(WGK) | 1 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DB9300000 |
| 관세 코드 | 29173980 |
| 위험 문구(R) | 41-42/43 |
| 위험 표시 | Xn |
| 안전 문구(S) | 22-24-26-37/39 |
| 기존화학 물질 | KE-02686 |
| F 고인화성물질 | 10-21 |
| 자연 발화 온도 | 630°C |
| 위험 등급 | Eye Dam. 1Resp. Sens. 1Skin Sens. 1 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 89-32-7(Hazardous Substances Data) |
용도
용도
Pyromellitic dianhydride (PMDA) is employed as a curing agent for epoxy agent resins used for casting, laminating, the manufacture of moulding powders, adhesives and coatings.
일반 설명
Pyromellitic dianhydride (PMDA) is an acidic anhydride that can be used as a repair agent and as a chain extender in the formation of polyethylene terephthalate (PET) based chain extensions. It is mainly used in the production of thermoplastics and other coating applications.
제조 및 합성 방법
제조 방법
Pyromellitic Dianhydride is prepared by gas-phase oxidation of 1,2,4,5-tetramethylbenzene (or related tetrasubstituted benzene derivatives). An idealized equation is:C6H2(CH3)4 + 6 O2 → C6H2(C2O3)2 + 6 H2OIn the laboratory, it can be prepared by dehydration of pyromellitic acid using acetic anhydride.