Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
p-Tolyltrichlorosilane
DK370 · Tolyltrichlorosilane · p-Tolyltrichlorosilane · TRICHLORO-P-TOLYLSILANE · p-Tolylsilyl trichloride · 4-TRICHLOROSILYL TOLUENE · Silane, trichloro-p-tolyl- · p-Tolyltrichlorosilane,94%
식별자 및 물리적 특성
| CAS No. | 701-35-9 |
|---|---|
| 분자식 | C7H7Cl3Si |
| 평균 분자량 | 225.6 g/mol |
| 단동위원소 질량 | 223.93826 g/mol |
| SMILES | Cc1ccc([Si](Cl)(Cl)Cl)cc1 |
| InChIKey | WOMUGKOOLXQCTQ-UHFFFAOYSA-N |
| PubChem CID | 69697 |
| EC No. | 211-854-0 |
| DTXSID | DTXSID6061026 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 124 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 끓는 점 | 218-220 °C (lit.) |
| 밀도 | 1.273 g/mL at 25 °C (lit.) |
| 증기압 | 0-4220000Pa at 20-25℃ |
| 굴절률 | n20/D 1.5240(lit.) |
| 인화점 | 210 °F |
| 저장 조건 | Store at room temperature, keep dry and cool |
| 물리적 상태 | liquid |
| 비중 | 1.28 |
| 용해도 | 물과 반응합니다. |
| BRN | 1866557 |
| InChI | 1S/C7H7Cl3Si/c1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,1H3 |
| InChIKey | WOMUGKOOLXQCTQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)[Si](Cl)(Cl)Cl |
| LogP(분배 계수) | -0.6 |
| NIST | 4-Tolyltrichlorosilane(701-35-9) |
| EPA | Silane, trichloro(4-methylphenyl)- (701-35-9) |
화학적 성질
Colorless or yellowish transparent liquid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | REACH registered substance: Trichloro-p-tolylsilane (EC: 211-854-0) |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 2987 8/PG 2 |
| 관세 코드 | 29319000 |
| 위험 문구(R) | 14-34 |
| 위험 표시 | C |
| 안전 문구(S) | 23-26-27-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
It can be used to produce 3-(p-Methylphenyl)cyclohexanon.