Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1'-히드록시-2'-아세토나프톤
1'-하이드록시-2'-아세토나프톤 · 1'-히드록시-2'-아세토나프톤 · 2-ACETYL-1-NAPHTHOL · 1-(1-HYDROXY-2-NAPHTHALENYL)ETHANONE · 2-ACETO-1-NAPHTHOL · TIMTEC-BB SBB010063 · RARECHEM BW GA 0421 · LABOTEST-BB LT00068557
식별자 및 물리적 특성
| CAS No. | 711-79-5 |
|---|---|
| 분자식 | C12H10O2 |
| 평균 분자량 | 186.21 g/mol |
| 단동위원소 질량 | 186.06807956 g/mol |
| SMILES | CC(=O)c1ccc2ccccc2c1O |
| InChIKey | JBGJVMVWYWUVOW-UHFFFAOYSA-N |
| PubChem CID | 69733 |
| ChEMBL | CHEMBL569194 |
| EC No. | 211-918-8 |
| DTXSID | DTXSID4061044 |
| 현지명 | 1'-히드록시-2'-아세토나프톤 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 224 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 98-100 °C(lit.) |
| 끓는 점 | 280.69°C (rough estimate) |
| 밀도 | 1.1032 (rough estimate) |
| 굴절률 | 1.6086 (estimate) |
| 저장 조건 | 2-8°C, stored under nitrogen |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | pK1: 13.40 (30°C) |
| 색상 | 노란색 |
| 용해도 | 물에 불용성. |
| BRN | 1868084 |
| InChI | InChI=1S/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| InChIKey | JBGJVMVWYWUVOW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C2C(=C1O)C=CC=C2)C |
| EPA | Ethanone, 1-(1-hydroxy-2-naphthalenyl)- (711-79-5) |
화학적 성질
yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29145000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-acetyl-1-naphthol and 1-acetyl-2-naphthol with triphosgene gave naphtho[1,2-e]-1,3-oxazines, naphtho[2,1-e]-1,3-oxazines or their spiro dimers depending on the molar ratio of triphosgene used for the cyclization.
일반 설명
The modulation of different photophysical properties of 1′-hydroxy-2′-acetonaphthone (HAN), after encapsulating into the hydrophobic nanocavities of various bile salt aggregates, was studied.