Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-클로로-2-니트로톨루엔
4-클로로-2-니트로톨루엔 · 5-CHLORO-2-METHYLNITROBENZENE · 4-chloro-1-methyl-2-nitro-benzene · 4-Chloro-2-nit · oro-2-nitrotoL · Chloro-2-nitrotolu · 4-Chloro-2-nitrotolu · 4-Chlor-2-nitrotoluol
식별자 및 물리적 특성
| CAS No. | 89-59-8 |
|---|---|
| 분자식 | C7H6ClNO2 |
| 평균 분자량 | 171.58 g/mol |
| 단동위원소 질량 | 171.00870611 g/mol |
| SMILES | Cc1ccc(Cl)cc1[N+](=O)[O-] |
| InChIKey | SQFLFRQWPBEDHM-UHFFFAOYSA-N |
| PubChem CID | 6975 |
| EC No. | 201-921-2 |
| DTXSID | DTXSID4058994 |
| 현지명 | 4-클로로-2-니트로톨루엔 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 157 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| LogP(분배 계수) | 3.05 |
| 녹는점 | 34-38 °C (lit.) |
| 끓는 점 | 239-240 °C/718 mmHg (lit.) |
| 밀도 | 1.2559 |
| 굴절률 | 1.5570 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Store below +30°C. |
| 물리적 상태 | powder to lump to clear liquid |
| 색상 | White or Colorless to Yellow |
| 용해도 | 109mg/L(20℃) |
| BRN | 2046651 |
| InChI | InChI=1S/C7H6ClNO2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | SQFLFRQWPBEDHM-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Cl)C=C1[N+]([O-])=O |
| NIST | 4-Chloro-2-nitrotoluene(89-59-8) |
| EPA | Benzene, 4-chloro-1-methyl-2-nitro- (89-59-8) |
화학적 성질
clear brown liquid after melting
안전 및 규제
| GHS 분류 | WarningH302 (14.6%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| DOT Hazard Classification | 4-Chloro-2-nitrotolueneMarine pollutant |
| Hazard Classes and Categories | Acute Tox. 4 (14.6%) |
| 수질 위해 등급(WGK) | 2 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3457 6.1/PG 3 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 36/37/38-20/21/22-52/53 |
| 위험 표시 | Xi,Xn,N |
| 안전 문구(S) | 26-36-36/37/39-61 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
4-Chloro-2-nitrotoluene can be used in the synthesis of indigo dye.
제조 및 합성 방법
생산 방법
4-Chlorotoluene is nitrated with mixed acid (39/59/2) at 25 ℃ to give a mixture of 4-Chloro-2-nitrotoluene (65 %) and 4-Chloro-3-nitrotoluene (35 %) isomers. The major component is separated as the lower boiling fraction on vacuum distillation. 4-Chloro-3-nitrotoluene [89-60-1] can be obtained, if required, from the residue by distillation and sweating.