Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
클로로(3-)벤질브로마이드
클로로(3-)벤질브로마이드 · 3-클로로벤질 브로마이드 · 1-(bromomethyl)-3-chlorobenzene · orobenzyL · ChlorobenzylbroMide · 3-Chlorobenzyl bromi · M-CHLOROBENZYL BROMIDE · 3-CHLOROBENZYL BROMIDE
식별자 및 물리적 특성
| CAS No. | 766-80-3 |
|---|---|
| 분자식 | C7H6BrCl |
| 평균 분자량 | 205.48 g/mol |
| 단동위원소 질량 | 203.93413997 g/mol |
| SMILES | Clc1cccc(CBr)c1 |
| InChIKey | LZIYAIRGDHSVED-UHFFFAOYSA-N |
| PubChem CID | 69838 |
| EC No. | 212-171-0 |
| DTXSID | DTXSID40227411 |
| 현지명 | 클로로(3-)벤질브로마이드 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 85 |
| 물질 분류 | Other Classes -> Halogenated Monoaromatics |
| Physical Description | Clear light brown liquid[Sigma-Aldrich MSDS] |
| 녹는점 | 15 °C |
| 끓는 점 | 109-110 °C/12 mmHg (lit.) |
| 밀도 | 1.565 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.588(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,2-8°C |
| 물리적 상태 | powder to lump to clear liquid |
| 색상 | White or Colorless to Yellow |
| 비중 | 1.565 |
| 용해도 | 물에서 분해되다 |
| BRN | 636504 |
| InChI | InChI=1S/C7H6BrCl/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| InChIKey | LZIYAIRGDHSVED-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(Cl)=C1 |
| NIST | Benzene, 1-(bromomethyl)-3-chloro-(766-80-3) |
화학적 성질
Colorless liquid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | 1-(Bromomethyl)-3-chlorobenzene: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Causes burns and lachrymationInhalation may cause corrosive injuries to upper respiratory tract[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 6.1Skin Corr. 1B |
| F 고인화성물질 | 19 |
| 위험 참고 사항 | Corrosive/Lachrymatory |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
3-Chlorobenzyl bromide was used in the synthesis of symmetrical and unsymmetrical benzyl thioethers. It was used as starting reagent during the synthesis of 1-(3-chlorobenzyl)-2-(pyrrolidin-1-ylmethyl)-1H-benzimidazole dihydrochloride.
일반 설명
3-Chlorobenzyl bromide reacts with aminoethanol and NaH to yield aminoethyl 3-chlorobenzyl ether.