Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-6-nitroaniline
2-Chloro-6-nitrobenzenamine · 2-CHLORO-6-NITROANILINE · 2-Nitro-6-chloroaniline · 2-Chloro-6-nitroaniline 97% · 2-Amino-3-chloronitrobenzene · 2-CHLORO-6-NITRO-PHENYLAMINE · 2-Chloro-6-nitroaniline, 95+% · Benzenamine, 2-chloro-6-nitro-
식별자 및 물리적 특성
| CAS No. | 769-11-9 |
|---|---|
| 분자식 | C6H5ClN2O2 |
| 평균 분자량 | 172.57 g/mol |
| 단동위원소 질량 | 172.00395508 g/mol |
| SMILES | Nc1c(Cl)cccc1[N+](=O)[O-] |
| InChIKey | VOTXWUCYIOPNNR-UHFFFAOYSA-N |
| PubChem CID | 69855 |
| EC No. | 212-204-9 |
| DTXSID | DTXSID60227690 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 71.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 159 |
| 녹는점 | 74-75 °C |
| 끓는 점 | 284.3±20.0 °C(Predicted) |
| 밀도 | 1.494±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| pKa(산도 계수) | pK1: 2.41(+1) (25°C) |
| 물리적 상태 | 크리스탈 |
| 색상 | 노란색 |
화학적 성질
2-Chloro-6-nitroaniline has been shown to have a magnetic property when dissolved in an acid solution.
안전 및 규제
| GHS 분류 | WarningH302 (95%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P272, P280, P301+P317, P302+P352, P321, P330, P333+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95%) |
| 관세 코드 | 2921420090 |
| 위험 표시 | Xi |
| 위험 참고 사항 | Irritant |
제조 및 합성 방법
제조 방법
2-Chloro-6-nitroaniline can be obtained by reacting naphthalene with nitric acid in the presence of a proton donor.