Indole-3-Carboxylic Acid
1H-INDOLE-3-CARBOXYLIC ACID · ICO · 3-CARBOXYINDOLE · 3-Indoleformic acid · e-3-carboxyL · 3-Indoleformic · 3-indoleic acid · 3-Indolecarboxylic
식별자 및 물리적 특성
| CAS No. | 771-50-6 |
|---|---|
| 분자식 | C9H7NO2 |
| 평균 분자량 | 161.16 g/mol |
| 단동위원소 질량 | 161.04767846 g/mol |
| SMILES | O=C(O)c1c[nH]c2ccccc12 |
| InChIKey | KMAKOBLIOCQGJP-UHFFFAOYSA-N |
| PubChem CID | 69867 |
| ChEMBL | CHEMBL387527 |
| ChEBI | CHEBI:24809 |
| EC No. | 212-231-6 |
| DTXSID | DTXSID50227886 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 53.1 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 193 |
| LogP(분배 계수) | 1.99 |
| 녹는점 | 206.5 °C232-234 °C (dec.)(lit.) |
| Physical Description | Solid |
| Collision Cross Section | 132.4 Ų [M+H]+ [CCS Type: DTMethod: single field calibrated with Agilent tune mix (Agilent)] |
| 끓는 점 | 287.44°C (rough estimate) |
| 밀도 | 1.2480 (rough estimate) |
| 굴절률 | 1.5050 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 95% 에탄올에 용해됨: 50mg/ml, 메탄올에도 용해됨. |
| pKa(산도 계수) | 3.90±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 라이트 베이지 |
| BRN | 129435 |
| InChI | InChI=1S/C9H7NO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,(H,11,12) |
| InChIKey | KMAKOBLIOCQGJP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C(O)=O)=C1 |
화학적 성질
light beige crystalline powder (recrystallized from acetate-petroleum ether). Soluble in ethanol, ether, acetate, insoluble in boiling water, benzene, insoluble in petroleum ether.
안전 및 규제
| GHS 분류 | WarningH302 (40%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 10 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (40%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | NK7882892 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38-21/22 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 22-24/25-36/37/39-26 |
| 위험 등급 | IRRITANT |
| 저장 분류 | 11 - Combustible Solids |
용도
일반 설명
The structures of the derivatives of indole-3-carboxylic acid were studied using gas chromatography with high resolution mass spectrometry (GC-HRMS), ultra-high performance liquid chromatography in combination with high resolution tandem mass spectrometry (UHPLC-HRMS), nuclear magnetic resonance spectroscopy (NMR) and Fourier transform infrared spectroscopy (FT-IR).
제조 및 합성 방법
제조 방법
indole-3-carboxylic acid can be synthesized by the hydrolysis reaction of 3-trichloroacetyl indole: add 235g 3-trichloroacetyl indole into 1000ml methanol, slowly drop an appropriate amount of 50% KOH solution, heat up and reflux for 18 hours, cool to room temperature, The methanol was recovered by concentration, and the residual liquid was left; 1500 ml of water was added to the residual liquid, hydrochloric acid was added dropwise to adjust pH=3～4, and then filtered, and the solid obtained by filtration was dried to obtain 144g of indole-3-carboxylic acid crude product; The crude product was slurried with 100g of ethyl acetate for 25 minutes,filtered and dried to obtain indole-3-carboxylic acid (137g, yield 91.8%).