Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
트리플르오르-1,2,3,-4니트로벤젠
트리플르오르-1,2,3,-4니트로벤젠 · 1,2,3-트라이플루오로-4-나이트로벤젠 · 2,3,4-TRIFLUORONITROBENZENE · 1,2,3-Trifluoro-4-ni · 4-chloro-2-fluroaniline · 4-Trifluoronitrobenzene · 2,3,4-Trifluornitrobenzene · 3,4,5 TRIFLUORONITROBENZEN
식별자 및 물리적 특성
| CAS No. | 771-69-7 |
|---|---|
| 분자식 | C6H2F3NO2 |
| 평균 분자량 | 177.08 g/mol |
| 단동위원소 질량 | 177.00376296 g/mol |
| SMILES | O=[N+]([O-])c1ccc(F)c(F)c1F |
| InChIKey | ARCACZWMYGILNI-UHFFFAOYSA-N |
| PubChem CID | 69871 |
| EC No. | 212-238-4 |
| DTXSID | DTXSID30227889 |
| 현지명 | 트리플르오르-1,2,3,-4니트로벤젠 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 184 |
| 끓는 점 | 92 °C/20 mmHg (lit.) |
| 밀도 | 1.541 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.492(lit.) |
| 인화점 | 200 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 색상 | Light yellow to Yellow to Orange |
| 비중 | 1.541 |
| BRN | 2449746 |
| InChI | InChI=1S/C6H2F3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChIKey | ARCACZWMYGILNI-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C([N+]([O-])=O)C(F)=C1F |
화학적 성질
clear yellow liquid after melting
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P262, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P317, P319, P321, P330, P332+P317, P333+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 83 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN2810 |
| 관세 코드 | 29042090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-36/37/39-24/25 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 기존화학 물질 | KE-34263 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2,3,4-Trifluoronitrobenzene was employed as starting reagent in the synthesis of ofloxacin. It was also used in the synthesis of the third generation quinolones antibacterial drugs.
일반 설명
2,3,4-Trifluoronitrobenzene is a fluoronitrobenzene and its biotransformation under methanogenic conditions has been studied by semicontinuous and batch tests. 2,3,4-Trifluoronitrobenzene is an important pharmaceutical intermediate.