Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Acetylfluorene
2-Acetofluorene · 2-ACETYLFLUORENE · 2-Acetyl fluolene · 2-Acetylfluorene97% · 2-Acetyl-9H-fluorene · 2-Acetylfluorene 97% · 2-Acetylfluorene,98% · 2-Acetylfluorene >2-fluorenylmethylketone
식별자 및 물리적 특성
| CAS No. | 781-73-7 |
|---|---|
| 분자식 | C15H12O |
| 평균 분자량 | 208.25 g/mol |
| 단동위원소 질량 | 208.088815 g/mol |
| SMILES | CC(=O)c1ccc2c(c1)Cc1ccccc1-2 |
| InChIKey | IBASEVZORZFIIH-UHFFFAOYSA-N |
| PubChem CID | 69908 |
| ChEMBL | CHEMBL3188728 |
| EC No. | 212-310-5 |
| DTXSID | DTXSID6049357 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 283 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 128-129 °C (lit.) |
| 끓는 점 | 307.46°C (rough estimate) |
| 밀도 | 1.0459 (rough estimate) |
| 굴절률 | 1.5361 (estimate) |
| 인화점 | 217 °C |
| 저장 조건 | Store at room temperature |
| 용해도 | 클로로포름에 용해됨 |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 1g/L(20℃) |
| BRN | 1871711 |
| InChI | InChI=1S/C15H12O/c1-10(16)11-6-7-15-13(8-11)9-12-4-2-3-5-14(12)15/h2-8H,9H2,1H3 |
| InChIKey | IBASEVZORZFIIH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C=CC2C3=C(CC=2C=1)C=CC=C3)C |
| NIST | 2-Acetylfluorene(781-73-7) |
화학적 성질
2-Acetylfl uorene is a light yellow crystalline powder and is stable under normal temperatures and pressures. 2-Acetylfl uorene is incompatible with strong oxidizing agents. On decomposition, it releases carbon monoxide and carbon dioxide.
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | OB3800000 |
| 관세 코드 | 29143990 |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
2-Acetylfluorene is a crystalline powder of light yellow and is stable under normal temperatures and pressures. 2-Acetylfluorene is incompatible with strong oxidising agents. 2-Acetylfluorene on decomposition releases carbon monoxide and carbon dioxide.