L-메티오닌
메티오닌 · L-(-)-메티오닌 · L-메티오닌 · METHIONINE · MET · H-MET-OH · L-MET · L-Met-OH
식별자 및 물리적 특성
| CAS No. | 63-68-3 |
|---|---|
| 분자식 | C5H11NO2S |
| 평균 분자량 | 149.21 g/mol |
| 단동위원소 질량 | 149.05104977 g/mol |
| SMILES | CSCC[C@H]([NH3+])C(=O)[O-] |
| InChIKey | FFEARJCKVFRZRR-BYPYZUCNSA-N |
| PubChem CID | 6992087 |
| ChEBI | CHEBI:57844 |
| 현지명 | L-메티오닌 |
화학 및 물리적 성질
| XLogP | -1.2 |
|---|---|
| 극성 표면적 | 93.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 91.4 |
| LogP(분배 계수) | -1.87 |
| 용해도 | 56.6 mg/mL1 M HCl: 0.5 M ， 20 °C, 투명, 무색 |
| 녹는점 | 284 °C284 °C (dec.)(lit.) |
| Physical Description | Solid |
| Dissociation Constants | 2.28 (at 25 °C) |
| 끓는 점 | 393.91°C (estimate) |
| 밀도 | 1,34g/cm |
| 굴절률 | 1.5216 (estimate) |
| 저장 조건 | 20-25°C |
| pKa(산도 계수) | 2.13(at 25℃) |
| 물리적 상태 | 고체 |
| 색상 | 하얀색 |
| 냄새 | 약간의 특유의 냄새 |
| pH | 5-7 (10g/l, H2O, 20℃) |
| 생물학적 소스 | synthetic |
| 용해도 | 녹는 |
| Merck | 14,5975 |
| BRN | 1722294 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 펩타이드 합성의약품(소분자) |
| InChI | 1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | FFEARJCKVFRZRR-BYPYZUCNSA-N |
| SMILES | CSCC[C@H](N)C(O)=O |
| LogP(분배 계수) | 0.217 (est) |
| NIST | L-Methionine(63-68-3) |
| EPA | L-Methionine (63-68-3) |
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | PD0457000 |
| 독성 | LD50 oral in rat: 36gm/kg |
| 관세 코드 | 29304010 |
| 위험 문구(R) | 33 |
| 안전 문구(S) | 24/25 |
| 기존화학 물질 | KE-01485 |
| F 고인화성물질 | 10-23 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 63-68-3(Hazardous Substances Data) |
용도
개요
Colorless or white lustrous plates, or a white crystalline powder. It has a slight, characteristic odor. It is soluble in water, in alkali solutions, and in dilute mineral acids. It is slightly soluble in alcohol and practically insoluble in ether.
용도
L-Methionine is used as an essential amino acid for human development and therapeutically acts as an antidote for acetaminophen poisoning. It serves as a chelating agent for heavy metals, as a flavoring agent and nutritional supplement for foods. It acts as a feed additive, vegetable oil enrichment and as a single cell protein. In addition to this, it is used as a hepatoprotectant and also acts as a lipotropic agent and prevents excess fat buildup in the liver.
일반 설명
Minute hexagonal plates from dilute alcohol.
제조 및 합성 방법
제조 방법
The production method of choice for L-methionine is still the enzymatic resolution of racemic N-acetyl-methionine using acylase from Aspergillus oryzae. The production is carried out in a continuously operated fixed-bed or enzyme membrane reactor.
생산 방법
Numerous methods have been described for manufacture of methionine, including hydrolysis of methionine amide )and 5-(bmethylmercaptoethyl)- hydantoin.